Ceftibuten

{{cs1 config|name-list-style=vanc}}

{{short description|Chemical to treat chronic bronchitis}}

{{Drugbox

| verifiedrevid = 443510665

| IUPAC_name = (6R,7R)-7-([(Z)-2-(2-Amino-1,3-thiazol-4-yl)-5-hydroxy-5-oxopent-2-enoyl]amino)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid

| image = Ceftibuten.svg

| width = 200

| tradename = Cedax

| Drugs.com = {{drugs.com|monograph|ceftibuten}}

| MedlinePlus = a698023

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 97519-39-6

| ATC_prefix = J01

| ATC_suffix = DD14

| PubChem = 5282242

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01415

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4445419

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = IW71N46B4Y

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D00922

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 3510

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1605

| C=15 | H=14 | N=4 | O=6 | S=2

| smiles = O=C2N1/C(=C\CS[C@@H]1[C@@H]2NC(=O)C(=C/CC(=O)O)\c3nc(sc3)N)C(=O)O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C15H14N4O6S2/c16-15-17-7(5-27-15)6(1-2-9(20)21)11(22)18-10-12(23)19-8(14(24)25)3-4-26-13(10)19/h1,3,5,10,13H,2,4H2,(H2,16,17)(H,18,22)(H,20,21)(H,24,25)/b6-1-/t10-,13-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = UNJFKXSSGBWRBZ-BJCIPQKHSA-N

}}

Ceftibuten is a third-generation cephalosporin antibiotic.{{cite journal | vauthors = Owens RC, Nightingale CH, Nicolau DP | title = Ceftibuten: an overview | journal = Pharmacotherapy | volume = 17 | issue = 4 | pages = 707–20 | date = 1997 | pmid = 9250548 | doi = 10.1002/j.1875-9114.1997.tb03746.x| s2cid = 32735943 | url = }}{{cite journal | vauthors = Guay DR | title = Ceftibuten: a new expanded-spectrum oral cephalosporin | journal = The Annals of Pharmacotherapy | volume = 31 | issue = 9 | pages = 1022–33 | date = September 1997 | pmid = 9296244 | doi = 10.1177/106002809703100913 | s2cid = 39852306 }} It is an orally administered agent, with two dosage forms, capsule or oral suspension. It is marketed by Pernix Therapeutics under the trade name Cedax.

Medical uses

{{main article|Cephalosporin}}

Ceftibuten is used to treat acute bacterial exacerbations of chronic bronchitis (ABECB), acute bacterial otitis media, pharyngitis, and tonsilitis. It is also indicated for pneumonia, infections of the urinary tract, enteritis, and gastroenteritis.{{Citation needed|date=May 2009}}

Adverse effects

In 3,000 patients, ceftibuten was well tolerated. The most frequent reactions were gastrointestinal and nausea.{{cn|date=March 2023}}

Susceptibility

Ceftibuten is active against Haemophilus influenzae, Moraxella catarrhalis, Escherichia coli, Klebsiella pneumoniae, K. oxytoca, Proteus vulgaris, P. mirabilis, P. providence, Salmonella sp., Shigella sp., Enterobacter sp., and Streptococcus sp.{{cn|date=March 2023}}

The following represents minimum inhibitory concentration (MIC) susceptibility data for a few clinically significant microorganisms:

  • Haemophilus influenzae: 0.015–1.0 μg/ml
  • Moraxella catarrhalis: 0.5–4.0  μg/ml
  • Streptococcus pneumoniae: 0.5–256 μg/ml {{cite web | title = Ceftibuten Susceptibility and Minimum Inhibitory Concentration Range (MIC) Data | url = http://www.toku-e.com/Assets/MIC/Ceftibuten.pdf | date = June 2020 | work = TOKU-E }}

References

{{Reflist}}