Chloralodol

{{short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 447909656

| IUPAC_name = 2-methyl-4-(2,2,2-trichloro-1-hydroxyethoxy)
pentan-2-ol

| image = Chloralodol.svg

| image_class = skin-invert-image

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_BR = C1

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}

| legal_CA =

| legal_UK =

| legal_US = Schedule III (No longer marketed in the US)

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 3563-58-4

| ATC_prefix = N05

| ATC_suffix = CC02

| PubChem = 19094

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2104116

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01534

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 18027

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = W8RD4N93R2

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07325

| C=8 | H=15 | Cl=3 | O=3

| smiles = ClC(Cl)(Cl)C(O)OC(CC(O)(C)C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C8H15Cl3O3/c1-5(4-7(2,3)13)14-6(12)8(9,10)11/h5-6,12-13H,4H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = QVFWZNCVPCJQOP-UHFFFAOYSA-N

}}

Chloralodol (Chlorhexadol) is a hypnotic/sedative.{{cite book | vauthors = Sittig M | publisher = William Andrew Publishing | chapter = Chloralodol | chapter-url = https://books.google.com/books?id=_J2ti4EkYpkC&dq=Chloralodol&pg=PA945 | title = Pharmaceutical Manufacturing Encyclopedia | date = 22 October 2013 | edition = 3rd | isbn = 978-0-8155-1856-3 | pages = 945–946 }} It is a Schedule III drug in the USA; however, it is not currently marketed in the United States so it is no longer prescribed.