Chlorcyclizine

{{Short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 437187307

| IUPAC_name = 1-[(4-Chlorophenyl)(phenyl)methyl]-4-methylpiperazine

| image = Chlorcyclizine.png

| tradename =

| Drugs.com = {{drugs.com|international|chlorcyclizine}}

| MedlinePlus = a682619

| pregnancy_category =

| legal_status = Rx-only

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 82-93-9

| ATC_prefix = R06

| ATC_suffix = AE04

| PubChem = 2710

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 2609

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = M26C4IP44P

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 22150

| C=18 | H=21 | Cl=1 | N=2

| smiles = Clc1ccc(cc1)C(c2ccccc2)N3CCN(CC3)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C18H21ClN2/c1-20-11-13-21(14-12-20)18(15-5-3-2-4-6-15)16-7-9-17(19)10-8-16/h2-10,18H,11-14H2,1H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = WFNAKBGANONZEQ-UHFFFAOYSA-N

}}

Chlorcyclizine (Di-Paralene, Mantadil, Pruresidine, Trihistan) is a first-generation antihistamine of the diphenylmethylpiperazine group marketed in the United States and certain other countries.{{cite book | author = Swiss Pharmaceutical Society | title = Index Nominum 2000: International Drug Directory (Book with CD-ROM) | publisher = Medpharm Scientific Publishers | location = Boca Raton | year = 2000 | isbn = 3-88763-075-0 | url = https://books.google.com/books?id=5GpcTQD_L2oC&q=Chlorcyclizine&pg=PA212}}{{cite book | vauthors = Triggle DJ | title = Dictionary of Pharmacological Agents | publisher = Chapman & Hall/CRC | location = Boca Raton | year = 1996 | isbn = 0-412-46630-9 | url = https://books.google.com/books?id=DeX7jgInYFMC&q=Chlorcyclizine&pg=PA417}}{{cite book | vauthors = Hall JA, Morton I | title = Concise dictionary of pharmacological agents: properties and synonyms | publisher = Kluwer Academic | year = 1999 | isbn = 0-7514-0499-3 | url = https://books.google.com/books?id=mqaOMOtk61IC&q=Chlorcyclizine&pg=PA72}} It is used primarily to treat allergy symptoms such as rhinitis, urticaria, and pruritus, and may also be used as an antiemetic. In addition to its antihistamine effects, chlorcyclizine has some anticholinergic, antiserotonergic, and local anesthetic properties.{{cite book | author = Dorland Staff | title = Dorland Dictionnaire Medical Bilingue Francais-anglais / Anglais-francais: + E-book a Telecharger | publisher = Elsevier (Educa Books) | year = 2008 | isbn = 978-2-84299-899-8 | url = https://books.google.com/books?id=tQNqwsnkK-QC&q=chlorcyclizine%20anticholinergic&pg=PA1152| edition = French }}{{cite journal | vauthors = Rogóz Z, Skuza G, Sowińska H | title = The effect of the antihistaminic drugs on the central action of 5-hydroxytryptophan in mice | journal = Polish Journal of Pharmacology and Pharmacy | volume = 33 | issue = 4 | pages = 459–465 | date = November 1981 | pmid = 6120505 }} It has been studied as a potential treatment for various flaviviruses like hepatitis C and Zika virus.{{cite journal | vauthors = He S, Lin B, Chu V, Hu Z, Hu X, Xiao J, Wang AQ, Schweitzer CJ, Li Q, Imamura M, Hiraga N, Southall N, Ferrer M, Zheng W, Chayama K, Marugan JJ, Liang TJ | display-authors = 6 | title = Repurposing of the antihistamine chlorcyclizine and related compounds for treatment of hepatitis C virus infection | journal = Science Translational Medicine | volume = 7 | issue = 282 | pages = 282ra49 | date = April 2015 | pmid = 25855495 | pmc = 6420960 | doi = 10.1126/scitranslmed.3010286 }}{{cite journal | vauthors = Chamoun-Emanuelli AM, Pécheur EI, Chen Z | title = Benzhydrylpiperazine compounds inhibit cholesterol-dependent cellular entry of hepatitis C virus | journal = Antiviral Research | volume = 109 | pages = 141–148 | date = September 2014 | pmid = 25019406 | doi = 10.1016/j.antiviral.2014.06.014 }}{{cite journal | vauthors = Santos FR, Nunes DA, Lima WG, Davyt D, Santos LL, Taranto AG, Ferreira JM | title = Identification of Zika Virus NS2B-NS3 Protease Inhibitors by Structure-Based Virtual Screening and Drug Repurposing Approaches | journal = Journal of Chemical Information and Modeling | volume = 60 | issue = 2 | pages = 731–737 | date = February 2020 | pmid = 31850756 | doi = 10.1021/acs.jcim.9b00933 | s2cid = 209409716 }}

See also

References

{{Reflist}}

{{Antiemetics}}

{{Analgesics}}

{{Antihistamines}}

{{Cholinergics}}

{{Histaminergics}}

{{Serotonergics}}

{{Piperazines}}

Category:H1 receptor antagonists

Category:4-Methylpiperazin-1-yl compounds

{{respiratory-system-drug-stub}}