Chlorozotocin
{{Short description|Chemical compound}}
{{Use dmy dates|date=May 2020}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 293076130
| IUPAC_name = 2-{[(2-Chloroethyl)(nitroso)carbamoyl]amino}-2-deoxy-D-glucose
| image = Chlorozotocin (Haworth).svg
| width = 160
| alt = Haworth projection of chlorozotocin
| tradename =
| pregnancy_AU =
| pregnancy_US =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 54749-90-5
| ATC_prefix = none
| PubChem = 451706
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = 3053LTY75Z
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = C19170
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 2094020
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 397854
| smiles = ClCCN(N=O)C(=O)N[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C9H16ClN3O7/c10-1-2-13(12-20)9(19)11-5(3-14)7(17)8(18)6(16)4-15/h3,5-8,15-18H,1-2,4H2,(H,11,19)/t5-,6+,7+,8+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = MKQWTWSXVILIKJ-LXGUWJNJSA-N
| C=9 | H=16 | Cl=1 | N=3 | O=7
}}
Chlorozotocin is a nitrosourea. It is used for cancer therapy.{{Citation needed|date=July 2011}}
The International Agency for Research on Cancer concluded it was "probably carcinogenic" in 1990{{Cite book|url=https://www.ncbi.nlm.nih.gov/books/NBK526156/|title=SUMMARY OF FINAL EVALUATIONS|last=Humans|first=IARC Working Group on the Evaluation of Carcinogenic Risk to|date=1990|publisher=International Agency for Research on Cancer|language=en}}
It is an analogue of streptozotocin.{{cite book| vauthors = Wolfe MM |title=Therapy of digestive disorders|url=https://books.google.com/books?id=gUrxEDKGfx4C&pg=PA477|year=2006|publisher=Elsevier Health Sciences|isbn=978-1-4160-0317-5|page=477}}
References
{{reflist}}
Category:Alkylating antineoplastic agents
Category:IARC Group 2A carcinogens
Category:Monosaccharide derivatives
Category:Chloroethyl compounds
{{antineoplastic-drug-stub}}