Cholesteryl oleyl carbonate
{{chembox
| Watchedfields = changed
| verifiedrevid = 443522530
| ImageFile = Cholesteryl oleyl carbonate.png
| ImageSize =
| ImageFile1 = Cholesteryl oleyl karbonát.jpg
| ImageSize1 =
| IUPACName = Cholest-5-en-3β-yl (9Z)-octadec-9-en-1-yl carbonate
| SystematicName = (1R,3aS,3bS,7S,9aR,9bS,11aR)-9a,11a-Dimethyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,3b,4,6,7,8,9,9a,9b,10,11,11a-tetradecahydro-1H-cyclopenta[a]phenanthren-7-yl (9Z)-octadec-9-en-1-yl carbonate
| OtherNames =
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4895486
| InChI1 = 1/C46H80O3/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-34-48-44(47)49-39-30-32-45(5)38(35-39)26-27-40-42-29-28-41(37(4)25-23-24-36(2)3)46(42,6)33-31-43(40)45/h14-15,26,36-37,39-43H,7-13,16-25,27-35H2,1-6H3/b15-14-/t37-,39+,40+,41-,42+,43+,45+,46-/m1/s1
| InChIKey1 = XMPIMLRYNVGZIA-TZOMHRFMBY
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 17110-51-9
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 95LLB1K2WE
| PubChem = 6364539
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C46H80O3/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-34-48-44(47)49-39-30-32-45(5)38(35-39)26-27-40-42-29-28-41(37(4)25-23-24-36(2)3)46(42,6)33-31-43(40)45/h14-15,26,36-37,39-43H,7-13,16-25,27-35H2,1-6H3/b15-14-/t37-,39+,40+,41-,42+,43+,45+,46-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = XMPIMLRYNVGZIA-TZOMHRFMSA-N
| SMILES1 = O=C(OCCCCCCCC\C=C/CCCCCCCC)O[C@@H]4C/C3=C/C[C@@H]1[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@H](C)CCCC(C)C)C)[C@@]3(C)CC4
| SMILES2 = C[C@H](CCCC(C)C)[C@H]4CC[C@@]3([H])[C@]2([H])CC=C1C[C@@H](OC(OCCCCCCCC/C=C\CCCCCCCC)=O)CC[C@@](C)1[C@]([H])2CC[C@@]34C}}
|Section2={{Chembox Properties
| Formula = C46H80O3
| MolarMass = 681.13 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
Cholesteryl oleyl carbonate (COC) is an organic chemical, a carbonate ester of cholesterol and oleyl alcohol with carbonic acid. It is a liquid crystal material forming cholesteric liquid crystals with helical structure. It is a transparent liquid, or a soft crystalline material with melting point around 20 °C. It can be used with cholesteryl nonanoate and cholesteryl benzoate in some thermochromic liquid crystals.
It is used in some hair colors,{{CPID|id=3775}} make-ups, and some other cosmetic preparations.
It can be also used as a component of the liquid crystals used for liquid crystal displays.