Chrysoine resorcinol

{{Redirect|Gold yellow|the colour|golden yellow}}

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 421100892

| ImageFile = Chrysoine resorcinol.svg

| ImageSize = 240px

| ImageAlt = Skeletal formula of chrysoine resorcinol as a sodium salt

| ImageFile1 = Chrysoine resorcinol sodium 3D spacefill.png

| ImageSize1 = 240

| ImageAlt1 = Space-filling model of chrysoine resorcinol as a sodium salt

| IUPACName = Sodium 4-[(2,4-dihydroxyphenyl)diazenyl]benzenesulfonate

| OtherNames = Sodium p-(2,4-dihydroxyphenylazo)benzenesulfonate; Chrysoine; Resorcinol Yellow; Gold Yellow; Yellow T; Tropaeolin O; Tropaeolin R; C.I. Food Yellow 8; C.I. Acid Orange 6; C.I. 14270

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 21106427

| InChI = 1/C12H10N2O5S.Na/c15-9-3-6-11(12(16)7-9)14-13-8-1-4-10(5-2-8)20(17,18)19;/h1-7,15-16H,(H,17,18,19);/q;+1/p-1/b14-13+;

| InChIKey = COEZWFYORILMOM-WTMITFMSBV

| InChI1 = 1/C12H10N2O5S.C6H6O2.Na/c15-9-3-6-11(12(16)7-9)14-13-8-1-4-10(5-2-8)20(17,18)19;7-5-2-1-3-6(8)4-5;/h1-7,15-16H,(H,17,18,19);1-4,7-8H;/q;;+1/p-1/b14-13+;;

| InChIKey1 = DJYSHZPRWDNEOL-MNMGBGISBV

| SMILES1 = [Na+].Oc2cc(O)ccc2/N=N/c1ccc(cc1)S([O-])(=O)=O.Oc1cccc(O)c1

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C12H10N2O5S.C6H6O2.Na/c15-9-3-6-11(12(16)7-9)14-13-8-1-4-10(5-2-8)20(17,18)19;7-5-2-1-3-6(8)4-5;/h1-7,15-16H,(H,17,18,19);1-4,7-8H;/q;;+1/p-1/b14-13+;;

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = DJYSHZPRWDNEOL-QDBORUFSSA-M

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 547-57-9

| PubChem = 6093186

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = NF91VMI73L

| SMILES = [Na+].Oc2cc(O)ccc2/N=N/c1ccc(cc1)S([O-])(=O)=O

| EINECS = 208-924-8

}}

|Section2={{Chembox Properties

| C=12 | H=9 | N=2 | Na=1 | O=5 | S=1

| Appearance = Orange-yellow solid

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = Partially soluble

}}

|Section3={{Chembox Hazards

| MainHazards =

| NFPA-H = 2

| NFPA-F = 1

| NFPA-R = 0

| NFPA-S =

| FlashPt =

| AutoignitionPt =

}}

}}

Chrysoine resorcinol is a synthetic azo dye which was formerly used as a food additive.{{Citation needed|date=November 2010}} In Europe, it was banned as a food additive in 1977.{{Cite web|url=http://eur-lex.europa.eu/LexUriServ/LexUriServ.do?uri=CELEX:31976L0399:EN:HTML|title=EUR-Lex - Official Journal of the European Union}} In the US, it was banned in 1988.{{Cite web |title=Chrysoine Resorcinol Properties, Molecular Formula, Applications - WorldOfChemicals |url=https://www.worldofchemicals.com/chemicals/chemical-properties/chrysoine-resorcinol.html |access-date=2022-07-12 |website=www.worldofchemicals.com}}

Chrysoine resorcinol can be used as a pH indicator with a color change between pH 11 and pH 12.7.

In colorimetry, it has an absorption maximum of 387 nm.

{{left|{{pH_indicator_template | indicator_name=Chrysoine resorcinol | low_pH=11.0 | high_pH=12.7 | low_pH_color=yellow | high_pH_color=red |high_pH_text=white }}}}

{{clear left}}