Cibinetide

{{Short description|Erythropoietin receptor agonist}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name =

| image = Cibinetide.svg

| width = 300px

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class = Erythropoietin receptor agonist

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 1208243-50-8

| CAS_supplemental =

| PubChem = 91810664

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank = DB13006

| ChemSpiderID = 35013013

| UNII = 9W5677JKDA

| KEGG = D11218

| ChEBI =

| ChEMBL = 3545305

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = ARA-290; ARA290; PHBSP; pHBSP peptide; pGlu-Glu-Gln-Leu-Glu-Arg-Ala-Leu-Asn-Ser-Ser; Pyroglutamate helix B surface peptide; UEQLERALNSS

| IUPAC_name = (4S)-5-[[(2S)-5-amino-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-4-amino-1-[[(2S)-1-[[(1S)-1-carboxy-2-hydroxyethyl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-1,4-dioxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-carboxy-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-5-oxo-4-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoic acid

| C=51 | H=84 | N=16 | O=21

| SMILES = C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)O)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(=O)N)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H]1CCC(=O)N1

| StdInChI = 1S/C51H84N16O21/c1-22(2)17-30(47(84)65-32(19-36(53)71)48(85)66-33(20-68)49(86)67-34(21-69)50(87)88)63-40(77)24(5)57-41(78)25(7-6-16-56-51(54)55)59-43(80)29(11-15-39(75)76)62-46(83)31(18-23(3)4)64-45(82)27(8-12-35(52)70)60-44(81)28(10-14-38(73)74)61-42(79)26-9-13-37(72)58-26/h22-34,68-69H,6-21H2,1-5H3,(H2,52,70)(H2,53,71)(H,57,78)(H,58,72)(H,59,80)(H,60,81)(H,61,79)(H,62,83)(H,63,77)(H,64,82)(H,65,84)(H,66,85)(H,67,86)(H,73,74)(H,75,76)(H,87,88)(H4,54,55,56)/t24-,25-,26-,27-,28-,29-,30-,31-,32-,33-,34-/m0/s1

| StdInChIKey = WZTIQQBMSJTRBR-WYKNNRPVSA-N

}}

Cibinetide ({{Abbrlink|INN|International Nonproprietary Name}}; {{Abbrlink|USAN|United States Adopted Name}}; developmental code name ARA-290) is an erythropoietin receptor agonist which is under development for the treatment of a variety of different medical conditions.{{cite web | title=Cibinetide - Araim Pharmaceuticals | website=AdisInsight | date=28 June 2022 | url=https://adisinsight.springer.com/drugs/800035038 | access-date=23 October 2024}}{{cite web | title=Delving into the Latest Updates on Cibinetide with Synapse | website=Synapse | date=8 October 2024 | url=https://synapse.patsnap.com/drug/c4639d40db674d34b3ad283c50f0cfa7 | access-date=23 October 2024}}{{cite journal | vauthors = Peng B, Kong G, Yang C, Ming Y | title = Erythropoietin and its derivatives: from tissue protection to immune regulation | journal = Cell Death Dis | volume = 11 | issue = 2 | pages = 79 | date = February 2020 | pmid = 32015330 | pmc = 6997384 | doi = 10.1038/s41419-020-2276-8 | url = }} It was also under development for the treatment of depressive disorders, but development for this indication was discontinued. The drug is under development by Araim Pharmaceuticals.