Cilazapril

{{short description|Antihypertensive drug of the ACE inhibitor class}}

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 460036705

| ImageFile = Cilazapril structure.svg

| ImageFile_Ref = {{chemboximage|correct|??}}

| ImageSize = 222

| ImageName = Kekulé, stereo, skeletal formula of cilazapril ((1S,9S)-9-[(2S)-2-yl]amin,-1-carbox)

| PIN = (1S,9S)-9-{[(2S)-1-Ethoxy-1-oxo-4-phenylbutan-2-yl]amino}-10-oxooctahydro-6H-pyridazino[1,2-a][1,2]diazepine-1-carboxylic acid

|Section1 = {{Chembox Identifiers

| IUPHAR_ligand = 6459

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 8Q9454114Q

| CASNo_Ref = {{cascite|changed|CAS}}

| CASNo = 88768-40-5

| PubChem = 56330

| PubChem1 = 40467985

| PubChem1_Comment = (1R,9S)-(2S)-butylamino isomer

| ChemSpiderID = 50831

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| KEGG = D07699

| KEGG_Ref = {{keggcite|correct|kegg}}

| ChEBI = 3698

| ChEMBL = 515606

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01340

| SMILES = CCOC(=O)C(CCc1ccccc1)NC1CCCN2CCCC(N2C1=O)C(O)=O

| StdInChI = 1S/C22H31N3O5/c1-2-30-22(29)18(13-12-16-8-4-3-5-9-16)23-17-10-6-14-24-15-7-11-19(21(27)28)25(24)20(17)26/h3-5,8-9,17-19,23H,2,6-7,10-15H2,1H3,(H,27,28)

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = HHHKFGXWKKUNCY-UHFFFAOYSA-N

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

}}

|Section2 = {{Chembox Properties

| C=22 | H=31 | N=3 | O=5

| LogP = 2.212

| pKa = 2.285

| pKb = 11.712

}}

|Section6={{Chembox Pharmacology

| ATCCode_prefix = C09

| ATCCode_suffix = AA08

| AdminRoutes = Oral

| Legal_UK = POM

}}

}}

Cilazapril is an angiotensin-converting enzyme inhibitor (ACE inhibitor) used for the treatment of hypertension and congestive heart failure.{{Cite journal

| last1 = Szucs | first1 = T.

| title = Cilazapril. A review

| journal = Drugs

| volume = 41

| pages = 18–24

| year = 1991

| issue = Suppl 1

| pmid = 1712267

| doi=10.2165/00003495-199100411-00005

| s2cid = 261123720

}}{{cite book|title=Austria-Codex|editor=Jasek, W|publisher=Österreichischer Apothekerverlag|location=Vienna|year=2007|edition=2007/2008|isbn=978-3-85200-181-4|language=German}}

It was patented in 1982 and approved for medical use in 1990.{{cite book |last1=Fischer |first1=Jnos |last2=Ganellin |first2=C. Robin |title=Analogue-based Drug Discovery |date=2006 |publisher=John Wiley & Sons |isbn=9783527607495 |page=469 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA469 |language=en}}