Cinchocaine

{{Short description|Local anaesthetic drug}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 460037677

| IUPAC_name = 2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide

| image = Cinchocaine.svg

| image2 = Cinchocaine 3D ball-and-stick.png

| tradename =

| Drugs.com = {{drugs.com|international|cinchocaine}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_UK =

| legal_US = OTC

| legal_status =

| routes_of_administration = topical, intravenous (for animal euthanasia)

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 7159

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 85-79-0

| ATC_prefix = C05

| ATC_suffix = AD04

| ATC_supplemental = {{ATC|D04|AB02}} {{ATC|N01|BB06}} {{ATC|S01|HA06}} {{ATC|S02|DA04}}

| PubChem = 3025

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00527

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 2917

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = L6JW2TJG99

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D00733

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 247956

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1086

| C=20 | H=29 | N=3 | O=2

| smiles = O=C(c1c2ccccc2nc(OCCCC)c1)NCCN(CC)CC

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C20H29N3O2/c1-4-7-14-25-19-15-17(16-10-8-9-11-18(16)22-19)20(24)21-12-13-23(5-2)6-3/h8-11,15H,4-7,12-14H2,1-3H3,(H,21,24)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = PUFQVTATUTYEAL-UHFFFAOYSA-N

}}

Cinchocaine (INN/BAN) or dibucaine (USAN) is an amide local anesthetic. Among the most potent and toxic of the long-acting local anesthetics, current use of cinchocaine is generally restricted to spinal and topical anesthesia.Martindale, The Extra Pharmacopoeia, 30th ed, p1006{{cite web | url = https://meshb.nlm.nih.gov/record/ui?ui=D003992 | title = Dibucaine | work = MeSH Browser | publisher = U.S. National Library of Medicine }} It is sold under the brand names Cincain, Nupercainal, Nupercaine and Sovcaine.