Clobenpropit

{{short description|Chemical compound}}

{{Drugbox

| IUPAC_name = N'-[(4-chlorophenyl)methyl]-1-[3-(3H-imidazol-4-yl)propylsulfanyl]formamidine

| image = Clobenpropit.svg

| tradename =

| pregnancy_category =

| legal_US = IND

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 145231-45-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = RKU631JF4H

| ATC_prefix = None

| ATC_suffix =

| PubChem = 2790

| IUPHAR_ligand = 1223

| ChemSpiderID = 2688

| ChEMBL = 14690

| C=14 | H=17 | Cl=1 | N=4 | S=1

| smiles = C1=CC(=CC=C1CN=C(N)SCCCC2=CN=CN2)Cl

}}

Clobenpropit is a histamine H₃ receptor antagonist.{{cite journal | vauthors = Sahlholm K, Nilsson J, Marcellino D, Fuxe K, Arhem P | title = The human histamine H3 receptor couples to GIRK channels in Xenopus oocytes | journal = European Journal of Pharmacology | volume = 567 | issue = 3 | pages = 206–210 | year = 2007 | pmid = 17537431 | doi = 10.1016/j.ejphar.2007.04.032 }} It has neuroprotective effects via stimulation of GABA release in brain cells in vitro.{{ cite journal | vauthors = Dai H, Fu Q, Shen Y, Hu W, Zhang Z, Timmerman H, Leurs R, Chen Z | title = The histamine H3 receptor antagonist clobenpropit enhances GABA release to protect against NMDA-induced excitotoxicity through the cAMP/protein kinase A pathway in cultured cortical neurons | journal = European Journal of Pharmacology | year = 2007 | volume = 563 | issue = 1–3 | pages = 117–123 | pmid = 17350613 | doi = 10.1016/j.ejphar.2007.01.069 }}