Clocental

{{Short description|Chemical compound}}

{{Distinguish|Placental}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (1-Ethynylcyclohexyl) N-carbamoylcarbamate

| synonyms = Dolcental

| image = Clocental.svg

| image_class = skin-invert-image

| alt = Structural formula

| image2 = Clocental molecule ball.png

| alt2 = Ball-and-stick model of the clocental molecule

| width = 200

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 562-94-7

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = UX2C2JZD57

| ATC_prefix =

| ATC_suffix =

| PubChem = 11231

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 10757

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL =

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG =

| C=10 | H=14 | N=2 | O=3

| smiles = C#CC1(CCCCC1)OC(=O)NC(=O)N

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C10H14N2O3/c1-2-10(6-4-3-5-7-10)15-9(14)12-8(11)13/h1H,3-7H2,(H3,11,12,13,14)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = CQVLNDZXTPGTFD-UHFFFAOYSA-N

}}

Clocental (dolcental) is a carbamate-derived sedative hypnotic.{{cite journal | vauthors = Keil W, Muschaweck R, Rademacher E | title = [Sedative and hypnotic effect of the 1-ethinyl-cyclohexyl-allophante-(1)] | language = DE | journal = Arzneimittel-Forschung | volume = 4 | issue = 8 | pages = 477–479 | date = August 1954 | pmid = 13198744 }}{{cite journal | vauthors = Preuss R, Kopp R | title = [Analysis of the renal excretion products of 1-ethinyl-cyclohexylacarbamate (valamine) & 1-ethinyl-cyclohexyl-allophanate (dolcental)] | language = DE | journal = Arzneimittel-Forschung | volume = 9 | issue = 4 | pages = 255–262 | date = April 1959 | pmid = 13651050 }}