Clometocillin

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = (2S,5R,6R)-6-([2-(3,4-dichlorophenyl)-2-methoxyacetyl]amino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid

| image = Clometacillin.svg

| tradename =

| Drugs.com = {{drugs.com|international|clometocillin}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 1926-49-4

| ATC_prefix = J01

| ATC_suffix = CE07

| ChEBI = 131732

| ChEMBL = 2106548

| PubChem = 71807

| DrugBank =

| ChemSpiderID = 64831

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = YI8LL014GF

| KEGG = D07236

| C=17 | H=18 | Cl=2 | N=2 | O=5 | S=1

| smiles = O=C(O)[C@@H]2N3C(=O)[C@@H](NC(=O)C(OC)c1ccc(Cl)c(Cl)c1)[C@H]3SC2(C)C

}}

Clometocillin (or clometacillin) is a penicillin.{{cite journal | vauthors = Vanhoof R | title = Comparative in-vitro activities of amoxycillin and penicillin against Streptococcus pneumoniae isolates | journal = The Journal of Antimicrobial Chemotherapy | volume = 42 | issue = 3 | pages = 397–8 | date = September 1998 | pmid = 9786482 | doi = 10.1093/jac/42.3.397 | doi-access = free }}{{cite book |title=Pharmaceutical Manufacturing Encyclopedia |date=2007 |publisher=William Andrew Publishing |location=Norwich, N.Y. |isbn=978-0-8155-1856-3 |pages=1091 |edition=3rd | chapter = Clometocillin | chapter-url=https://books.google.com/books?id=_J2ti4EkYpkC&dq=Clometocillin&pg=PA1091}}