Cloranolol
{{chembox
| ImageFile=Cloranolol.svg
| IUPACName=(RS)-1-(tert-butylamino)-3-(2,5-dichlorophenoxy)propan-2-ol
| OtherNames=
|Section1={{Chembox Identifiers
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Q3U058H86V
| ChemSpiderID = 59229
| InChI = 1/C13H19Cl2NO2/c1-13(2,3)16-7-10(17)8-18-12-6-9(14)4-5-11(12)15/h4-6,10,16-17H,7-8H2,1-3H3
| InChIKey = XYCMOTOFHFTUIU-UHFFFAOYAX
| CASNo=39563-28-5
| PubChem=65814
| ChEMBL = 156791
| KEGG = D07183
| SMILES = Clc1ccc(Cl)cc1OCC(O)CNC(C)(C)C
}}
|Section2={{Chembox Properties
| C=13 | H=19 | Cl=2 | N=1 | O=2
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section6={{Chembox Pharmacology
| ATCCode_prefix = C07
| ATCCode_suffix = AA27
}}
|Section7={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
Cloranolol (Tobanum) is a beta blocker.{{cite journal |journal = Arzneimittelforschung |date = July 1989 |volume = 39 |pages = 782–5 |title = Action of beta-adrenoceptor blockers on liver function of rats |author = Kulcsár-Gergely J. |issue = 7 |pmid=2571334 }}
Synthesis
β-Adrenergic blocker. Prepn:G. Richter, {{Cite patent|country=DE|number=2213044|pubdate=1972-09-28|title=Racemisches und optisch aktives 1-(2,5-Dichlorphenoxy)-3-tert.butylamino-2-propanol und ihre Salze, sowie ihre Verwendung und Verfahren zu deren Herstellung derselben [Racemic and optically active 1-(2,5-dichlorophenoxy)-3-tertbutylamino-2-propanols and their salts, as well as their use and process for their preparation]|assign=Richter Gedeon Vegyeszeti Gyar R.T.}}.