Cloxotestosterone acetate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [2,2,2-trichloro-1-[[(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]oxy]ethyl] acetate

| image = Cloxotestosterone acetate.svg

| width = 250px

| image2 = Cloxotestosterone acetate molecule ball.png

| width2 = 250px

| tradename = Caprosem

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Intramuscular injection

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 13867-82-8

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 20056698

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 16739648

| UNII = 2X9YIP66ZO

| KEGG =

| ChEBI =

| ChEMBL =

| synonyms = Testosterone 17β-chloral hemiacetal O-acetate; 17β-(1-(Acetyloxy)-2,2,2-trichloroethoxy)androst-4-en-3-one

| C=23 | H=31 | Cl=3 | O=4

| SMILES = CC(=O)OC(C(Cl)(Cl)Cl)O[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C

| StdInChI_Ref =

| StdInChI = 1S/C23H31Cl3O4/c1-13(27)29-20(23(24,25)26)30-19-7-6-17-16-5-4-14-12-15(28)8-10-21(14,2)18(16)9-11-22(17,19)3/h12,16-20H,4-11H2,1-3H3/t16-,17-,18-,19-,20?,21-,22-/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = SJWGVEPLFJGWNB-UWSXKFMVSA-N

}}

Cloxotestosterone acetate ({{abbrlink|INN|International Nonproprietary Name}}; brand name Caprosem), also known as testosterone 17β-chloral hemiacetal O-acetate, is a synthetic, injected anabolic–androgenic steroid (AAS) and an androgen ether and ester – specifically, the O-acetate ester of cloxotestosterone, the 17β-trichloro hemiacetal ether of testosterone.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA641|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=641–}} It is administered via intramuscular injection, as a 100 mg, 2 mL aqueous suspension and lasts 4 to 6 weeks with a single administration.{{cite journal |title=Advertisements |journal=Proceedings of the Royal Society of Medicine |year=1963 |volume=56 |issue=1 |pmc=1896961 }}{{vs|date=February 2020}}{{Unreliable source?|date=February 2020}} The drug was first marketed in the early 1960s.