Cobalt(II) oxalate

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 428889740

| Name =

| ImageFile = Cobalt (II) oxalate.jpg

| ImageFile1 = Cobalt(II)-oxalate-dihydrate-from-xtal-2005-CM-3D-balls.png

| ImageSize = 300

| ImageAlt =

| ImageSize1 = 300

| IUPACName =

| PIN =

| SystematicName =

| OtherNames =

| Section1 = {{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 814-89-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = R028MNY8UA

| PubChem = 69946

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 63139

| SMILES = C(=O)(C(=O)[O-])[O-].[Co+2]

| InChI = 1/C2H2O4.Co/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+2/p-2

| InChIKey = MULYSYXKGICWJF-NUQVWONBAF

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C2H2O4.Co/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+2/p-2

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = MULYSYXKGICWJF-UHFFFAOYSA-L}}

| Section2 = {{Chembox Properties

| Formula = CoC₂O₄

| MolarMass = 146.9522 g/mol

| Appearance = gray/pink powder

| Odor = odorless

| Density = 3.01 g/cm³

| MeltingPtC = 250

| MeltingPt_notes = (decomposes)

| BoilingPt =

| Solubility = }}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

| Section4 =

| Section5 =

| Section6 =

}}

Cobalt(II) oxalate is the inorganic compound with the formula of CoC₂O₄. Like other simple inorganic oxalates, it is a coordination polymer. The oxalate ligands bridge of Co(OH₂)₂ centres. Each cobalt adopts octahedral coordination geometry.{{ cite journal | journal = Acta Crystallogr. C | volume = 61 | year = 2005 | pages = m58–m60 | title = catena-Poly[[diaquacobalt(II)]-μ-oxalato] | first1 = J. | last1 = Bacsa | first2 = D. | last2 = Eve | first3 = K. R. | last3 = Dunbar | issue = Pt 1 | doi = 10.1107/S0108270104030409 | pmid = 15640580 }}

It is used in the preparation of cobalt catalysts, and cobalt metal powder for powder-metallurgical applications. It is made in process of recycling lithium-ion batteries, where the cobalt is obtained from cathode material (LiCoO₂) by leaching with sulfuric acid and then precipitated with ammonium oxalate.{{cn|date=September 2023}}