Cod-THC

{{Short description|Synthetic chemical compound}}

{{Drugbox

| IUPAC_name = [(4R,4aR,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] [(6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] carbonate

| image = Cod_THC_structure.png

| image_class = skin-invert-image

| width = 220

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| excretion =

| CAS_number =

| CAS_number_Ref = {{Cascite|correct|EPA}}

| PubChem =

| ChemSpiderID =

| ChEMBL =

| ChEBI =

| UNII =

| C=40 | H=49 | N=1 | O=6

| smiles = CN1CC[C@@]23c4c5C[C@@H]1[C@@H]2C=C[C@H](OC(=O)Oc1cc(CCCCC)cc2OC(C)(C)[C@@H]6CCC(C)=C[C@H]6c21)[C@@H]3Oc4c(OC)cc5

| StdInChI = InChI=1S/C40H49NO6/c1-7-8-9-10-24-20-32(34-26-19-23(2)11-13-27(26)39(3,4)47-33(34)21-24)45-38(42)44-31-16-14-28-29-22-25-12-15-30(43-6)36-35(25)40(28,37(31)46-36)17-18-41(29)5/h12,14-16,19-21,26-29,31,37H,7-11,13,17-18,22H2,1-6H3/t26-,27-,28+,29-,31+,37+,40+/m1/s1

| StdInChIKey = VDTVNOCXWSYPQX-IWHNUUHWSA-N

}}

Cod-THC (Codeine Δ⁹-tetrahydrocannabinol carbonate) is a synthetic codrug formed by linking tetrahydrocannabinol with codeine via a carbonate bridge. It is well absorbed orally and shows superior analgesic effects in animal studies compared to a simple mixture of the two drugs.{{cite journal | vauthors = Banerjee A, Hayward JJ, Trant JF | title = "Breaking bud": the effect of direct chemical modifications of phytocannabinoids on their bioavailability, physiological effects, and therapeutic potential | journal = Organic & Biomolecular Chemistry | volume = 21 | issue = 18 | pages = 3715–3732 | date = May 2023 | pmid = 36825573 | doi = 10.1039/d3ob00068k | s2cid = 256792029 }}{{cite patent | country = US | number = 2008/0176885 | url = https://patents.google.com/patent/US20080176885 | inventor = Holtman JR, Crooks PA, Dhooper HK | assign1 = University of Kentucky | assign2 = Insys Therapeutics Inc. | pubdate = 24 July 2008 | title = Novel synergistic opioid-cannabinoid codrug for pain management. }}{{cite book | vauthors = Crooks PA, Dhooper HK, Chakraborty U | chapter = Improving the Use of Drug Combination through the Codrug Approach | veditors = Rautio J | title = Prodrugs and Targeted Delivery: Towards Better ADME Properties. | publisher = Wiley | date = 2011 | isbn = 978-3-527-63318-0 | pages = 345–383 (374–376) }}