Codoxime

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = (((4,5α-Epoxy-3-methoxy-17-methylmorphinan-6-ylidene)amino)oxy)acetic acid

| image = Codoxime.svg

| image_class = skin-invert-image

| width = 220

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_BR = A1

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}

| legal_CA = Schedule I

| legal_UK =

| legal_US =

| legal_UN = N I

| legal_DE = Anlage I

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 7125-76-0

| ATC_prefix = none

| ATC_suffix =

| PubChem = 9570253

| DrugBank =

| ChEMBL = 2107300

| ChemSpiderID = 7844721

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = JT5I2F57F7

| KEGG = D03581

| C=20 | H=24 | N=2 | O=5

| smiles = O=C(O)CO\N=C4\[C@@H]5Oc1c2c(ccc1OC)C[C@H]3N(CC[C@]25[C@H]3CC4)C

| synonyms = Codoxime

}}

Codoxime (Codossima) is an opiate analogue that is a derivative of hydrocodone, where the 6-ketone group has been replaced by carboxymethyloxime. It has primarily antitussive effects{{cite patent |country= US |number= 3153042 |status= granted |title= Morphinone and Codeinone Derivatives |pubdate= |gdate= 13 October 1964 |fdate= |pridate= |inventor = Jack Fishman |assign1= Mozes Juda Lowenstein }} and was found to have moderate potential to cause dependence in animal studies.{{cite journal | vauthors = Jasinski DR, Martin WR | title = Assessment of the dependence-producing properties of dihydrocodeinone and codoxime | journal = Clinical Pharmacology and Therapeutics | volume = 8 | issue = 2 | pages = 266–70 | date = 1967 | pmid = 6021586 | doi = 10.1002/cpt196782266 | s2cid = 36504901 }}

References