Colterol

{{Short description|Chemical compound}}

{{Infobox drug

| drug_name =

| INN =

| type =

| IUPAC_name = 4-[2-(tert-Butylamino)-1-hydroxyethyl]benzene-1,2-diol

| image = Colterol.svg

| alt =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_US =

| pregnancy_category=

| routes_of_administration =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_DE =

| legal_NZ =

| legal_UK =

| legal_US =

| legal_UN =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 18866-78-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 1WH11068UO

| class =

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| PubChem = 25104

| ChemSpiderID = 23451

| DrugBank =

| synonyms = N-tert-Butylarterenol; N-tert-Butylnoradrenaline

| C=12|H=19|N=1|O=3

| StdInChI=1S/C12H19NO3/c1-12(2,3)13-7-11(16)8-4-5-9(14)10(15)6-8/h4-6,11,13-16H,7H2,1-3H3

| StdInChIKey=PHSMOUBHYUFTDM-UHFFFAOYSA-N

| smiles = CC(C)(C)NCC(C1=CC(=C(C=C1)O)O)O

}}

Colterol is a short-acting β2-adrenoreceptor agonist. Bitolterol, a prodrug for colterol,{{cite journal | vauthors = Walker SB, Kradjan WA, Bierman CW | title = Bitolterol mesylate: a beta-adrenergic agent. Chemistry, pharmacokinetics, pharmacodynamics, adverse effects and clinical efficacy in asthma | journal = Pharmacotherapy | volume = 5 | issue = 3 | pages = 127–37 | date = 6 May 1985 | pmid = 3895171 | doi = 10.1002/j.1875-9114.1985.tb03410.x | s2cid = 29431526 }} is used in the management of bronchospasm in asthma and chronic obstructive pulmonary disease (COPD).

Patents:Aktiengesellschaft F Hoffmann, CH263801 (1949-09-15 to Hoffmann La Roche).Yasuo Konishi, Joanne Magoon, Suwatchai Jarussophon, WO2008092257 (2008 to National Research Council Of Canada). Location in patent: Page column 17.

References

{{reflist}}

{{Adrenergic receptor modulators}}

Category:Beta2-adrenergic agonists

{{pharma-stub}}