Combretastatin A-1

{{Use dmy dates|date=August 2024}}

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 460120971

| Name = Combretastatin A-1

| ImageFile = Combretastatin A-1.svg

| ImageSize = 200px

| PIN = 3-Methoxy-6-[(E)-2-(3,4,5-trimethoxyphenyl)ethen-1-yl]benzene-1,2-diol

| OtherNames = Combretastatin A1; OXi4500

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 109971-63-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2222ATS339

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 520204

| PubChem = 6078282

| SMILES = COC1=C(C(=C(C=C1)C=CC2=CC(=C(C(=C2)OC)OC)OC)O)O

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4800178

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = YUSYSJSHVJULID-AATRIKPKSA-N

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI=1S/C18H20O6/c1-21-13-8-7-12(16(19)17(13)20)6-5-11-9-14(22-2)18(24-4)15(10-11)23-3/h5-10,19-20H,1-4H3/b6-5+

}}

|Section2={{Chembox Properties

| C=18 | H=20 | O=6

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Combretastatin A-1 is a combretastatin and a stilbenoid. It can be found in Combretum afrum, the Eastern Cape South African Bushwillow tree.{{Cite journal | last1 = Pettit | first1 = G. R. | last2 = Singh | first2 = S. B. | last3 = Niven | first3 = M. L. | last4 = Hamel | first4 = E. | last5 = Schmidt | first5 = J. M. | title = Isolation, Structure, and Synthesis of Combretastatins A-1 and B-1, Potent New Inhibitors of Microtubule Assembly, Derived from Combretum caffrum | doi = 10.1021/np50049a016 | journal = Journal of Natural Products | volume = 50 | issue = 1 | pages = 119–131 | year = 1987 | pmid = 3598594}}