Copper(II) perchlorate

{{Chembox

| verifiedrevid = 449203454

| ImageFile = Copper(II) perchlorate.svg

| ImageSize = 180px

| ImageName = Copper(II) perchlorate hexahydrate

| ImageFile1 = Copper(II)-perchlorate-hexahydrate-unit-cell-3D-bs-17.png

| ImageCaption1 = Copper(II) perchlorate hexahydrate

| ImageFile2 = Copper(II)_perchlorate_hexahydrate.JPG

| ImageCaption2 = Copper(II) perchlorate hexahydrate

| IUPACName = Copper(II) perchlorate

| OtherNames = Cupric perchlorate

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref =

| ChemSpiderID = 26246

| EC_number = 237-391-4

| InChI =

| SMILES = [O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[Cu+2]

| InChIKey =

| StdInChI = 1S/2ClHO4.Cu/c2*2-1(3,4)5;/h2*(H,2,3,4,5);/q;;+2/p-2

| StdInChIKey_Ref =

| StdInChIKey = YRNNKGFMTBWUGL-UHFFFAOYSA-L

| CASNo = 10294-46-9

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo_Comment = (hexahydrate)

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 57JSH2LO1G

| PubChem = 28211

| PubChem_Comment = (hexahydrate)

| RTECS =

}}

|Section2={{Chembox Properties

| Formula = {{chem2|Cu(ClO4)2}} (anhydrous)

| MolarMass = 262.447 g/mol (anhydrous)
370.539 g/mol (hexahydrate)

| Appearance = Blue crystalline hygroscopic solid (hexahydrate)

| Odor = odorless

| Density = 2.225 g/cm³ (hexahydrate)

| Solubility = 146 g/(100 ml) (30°C)

| MeltingPtC = 82

| MeltingPt_notes = (hexahydrate)

| BoilingPtC = 120

| BoilingPt_notes = (hexahydrate)

| RefractIndex = 1.505 (hexahydrate){{Cite web|url=http://www.chemicalbook.com/ChemicalProductProperty_EN_CB2471598.htm|title = Copper(Ii) Perchlorate Hexahydrate | 10294-46-9}}

| pKa =

| pKb =

| Viscosity =

}}

|Section7={{Chembox Hazards

| ExternalSDS = [https://www.fishersci.ca/viewmsds.do?catNo=AC201361000 External MSDS]

| MainHazards =

| FlashPtC =

| FlashPt_notes =

| GHSPictograms = {{GHS03}}{{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|272|315|319|335}}

| PPhrases = {{P-phrases|210|220|221|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|370+378|403+233|405|501}}

| LD50 =

| PEL = TWA 1 mg/m³ (as Cu){{PGCH|0150}}

| REL = TWA 1 mg/m³ (as Cu)

| IDLH = TWA 100 mg/m³ (as Cu)

}}

}}

Copper(II) perchlorate is an inorganic compound with the chemical formula {{chem2|Cu(ClO4)2}}. It forms hydrates with the formula {{chem2|Cu(ClO4)2(H2O)_{x}|}}. The anhydrous solid is rarely encountered but several hydrates are known. Most important is the perchlorate salt of the copper aquo complex copper(II) perchlorate hexahydrate, {{chem2|[Cu(H2O)6](2+)(ClO4-)2}}.{{cite journal | title = Structure of copper(II) perchlorate hexahydrate | first1 = J. C. | last1 = Gallucci | first2 = R. E. | last2 = Gerkin | journal = Acta Crystallogr. C | year = 1989 | volume = 45 | issue = 9 | pages = 1279–1284 | doi = 10.1107/S0108270189000818 | pmid = 2557867 }}

Infrared spectroscopic studies of anhydrous copper(II) perchlorate provided some of the first evidence for the binding of perchlorate anion to a metal ion.{{cite journal |doi=10.1039/JR9610003091 |title=592. The infrared spectra of some transition-metal perchlorates |date=1961 |last1=Hathaway |first1=B. J. |last2=Underhill |first2=A. E. |journal=Journal of the Chemical Society (Resumed) |page=3091 }} The structure of this compound was eventually deduced by X-ray crystallography. Copper resides in a distorted octahedral environment and the perchlorate ligands bridge between the Cu(II) centers.{{cite journal |doi=10.1016/S0010-8545(98)00102-7 |title=Inorganic Perchlorato Complexes |date=1998 |last1=Pascal |first1=Jean-Louis |last2=Favier |first2=Frédéric |journal=Coordination Chemistry Reviews |volume=178-180 |pages=865–902 }}