Copper(II) triflate

{{chembox

| Watchedfields = changed

| verifiedrevid = 434072014

| Name = Copper(II) triflate

| ImageFile = Copper(II) triflate.png

| ImageName = Copper(II) triflate

| IUPACName = Copper(II) trifluoromethanesulfonate

| OtherNames = Copper(II) triflate

|Section1={{Chembox Identifiers

| SMILES = [Cu+2].FC(F)(F)S([O-])(=O)=O.FC(F)(F)S([O-])(=O)=O

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 2016731

| PubChem = 2734996

| InChI = 1/2CHF3O3S.Cu/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7);/q;;+2/p-2

| InChIKey = SBTSVTLGWRLWOD-NUQVWONBAL

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/2CHF3O3S.Cu/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7);/q;;+2/p-2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = SBTSVTLGWRLWOD-UHFFFAOYSA-L

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 34946-82-2

| RTECS =

}}

|Section2={{Chembox Properties

| Cu=1 | F=6 | O=6 | C=2 | S=2

| Appearance = white to pale blue powder

| Density =

| Solubility = very soluble, hygroscopic

| MeltingPt =

| BoilingPt =

| pKa =

| pKb =

}}

|Section7={{Chembox Hazards

| ExternalSDS =

| MainHazards =

| FlashPt =

| PEL = TWA 1 mg/m³ (as Cu){{PGCH|0150}}

| REL = TWA 1 mg/m³ (as Cu)

| IDLH = TWA 100 mg/m³ (as Cu)

}}

}}

Copper(II) triflate is the copper(II) salt of trifluoromethanesulfonic acid (known simply as triflic acid) which has a chemical formula of Cu(OSO₂CF₃)₂, abbreviated Cu(OTf)₂. This substance, first reported in 1972,{{cite journal | title = Solvolytic Routes via Alkylcopper Intermediates in the Electron-Transfer Oxidation of Alkyl Radicals | journal = Journal of the American Chemical Society | last = Jenkins | first = C.L. | last2 = Kochi | first2 = J.K. | volume = 94 | issue = 3 | year = 1972 | pages = 843–855 | doi = 10.1021/ja00758a024}} is a powerful Lewis acid. It is used as a catalyst in several organic reactions, such as the Diels–Alder reaction{{cite journal | journal = Journal of the American Chemical Society | title = Chiral Bis(oxazoline)copper(II) Complexes as Lewis Acid Catalysts for the Enantioselective Diels–Alder Reaction | volume = 121 | issue = 33 | pages = 7559–7573 | last = Evans | first = D.A. | last2 = Miller | first2 = S.J. | last3 = Lectka | first3 = T. | last4 = von Matt | first4 = P. | year = 1999 | doi = 10.1021/ja991190k}} and cyclopropanation reactions{{cite journal | journal = Journal of the American Chemical Society | volume = 95 | issue = 10 | pages = 3300–3310 | last = Salomon | first = R.G. | last2 = Kochi | first2 = J.K | title = Copper(I) catalysis in cyclopropanations with diazo compounds. Role of olefin coordination | year = 1973 | doi = 10.1021/ja00791a038}} (much like rhodium(II) acetate).