Copper ibuprofenate

{{chembox

| Watchedfields = changed

| verifiedrevid = 424908581

| Name =

| ImageFile = Copper(II) Ibuprofenate.jpg

| ImageFile1 = IBPCOP.jpg

| IUPACName = bis[2-(4-isobutylphenyl)propionato]copper(II)

| OtherNames =

| SystematicName =

| Section1 = {{Chembox Identifiers

| Abbreviations =

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 66840-44-6

| EINECS =

| PubChem =

| SMILES = c0cc(CC(C)C)ccc0C(C)[C-](O[Cu+2]123)O[Cu+2](O[C-](O1)C(C)c0ccc(CC(C)C)cc0)(O[C-](O2)C(C)c0ccc(CC(C)C)cc0)O[C-](O3)C(C)c0ccc(CC(C)C)cc0

| StdInChI=1S/4C13H17O2.2Cu/c4*1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15;;/h4*4-7,9-10H,8H2,1-3H3;;/q4*-3;2*+6

| StdInChIKey=HEFOJHHJEKPEDO-UHFFFAOYSA-N

| RTECS =

| MeSHName =

| ChEBI =

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG =

}}

| Section2 = {{Chembox Properties

| C=52 | H=68 | O=8 | Cu=2

| Appearance = Green powder

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility = Slightly soluble

| SolubleOther = Slightly soluble

| Solvent = isopropanol

| pKa =

| pKb = }}

| Section3 = {{Chembox Structure

| CrystalStruct =

| Coordination =

| MolShape = }}

| Section4 = {{Chembox Thermochemistry

| DeltaHf =

| DeltaHc =

| Entropy =

| HeatCapacity = }}

| Section5 = {{Chembox Pharmacology

| AdminRoutes =

| Bioavail =

| Metabolism =

| HalfLife =

| ProteinBound =

| Excretion =

| Legal_status =

| Legal_US =

| Legal_UK =

| Legal_AU =

| Legal_CA =

| Pregnancy_category =

| Pregnancy_AU =

| Pregnancy_US = }}

| Section6 = {{Chembox Explosive

| ShockSens =

| FrictionSens =

| DetonationV =

| REFactor = }}

| Section7 = {{Chembox Hazards

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| PEL = }}

| Section8 = {{Chembox Related

| OtherAnions =

| OtherCations =

| OtherFunction =

| OtherFunction_label =

| OtherCompounds = Copper aspirinate

Ibuprofen}}

}}

Copper ibuprofenate is a chemical complex consisting of copper(II) and the chelate form of the anti-inflammatory drug ibuprofen.{{cite journal|last=Frazier|first=D. R. |author2=S. K. Lynch |author3=G. O. Carlisle|year=1981|title=Synthesis and magnetic properties of bis[2-(4-isobutylphenyl)propionato]copper(II) |journal=Journal of Inorganic and Nuclear Chemistry|volume=43|issue=11|pages=2747–2748 | doi = 10.1016/0022-1902(81)80610-0}}{{cite journal |author=Abuhijleh AL |title=Mononuclear and binuclear copper(II) complexes of the antiinflammatory drug ibuprofen: synthesis, characterization, and catecholase-mimetic activity |journal=J. Inorg. Biochem. |volume=55 |issue=4 |pages=255–62 |date=September 1994 |pmid=7964714 |doi= 10.1016/0162-0134(94)85010-0}} The compound is prepared by the reaction of sodium ibuprofenate with copper(II) sulfate.

It has been suggested that copper complexes of anti-inflammatory drugs are more active than the parent drug{{cite journal |author=Sorenson JR |title=Copper complexes offer a physiological approach to treatment of chronic diseases |journal=Prog Med Chem |series=Progress in Medicinal Chemistry |volume=26 |pages=437–568 |year=1989 |pmid=2690187 |doi= 10.1016/s0079-6468(08)70246-7|isbn=9780444810380 }} and produce fewer gastrointestinal side-effects.{{cite journal |vauthors=Gordijo CR, Barbosa CA, Da Costa Ferreira AM, Constantino VR, de Oliveira Silva D |title=Immobilization of ibuprofen and copper-ibuprofen drugs on layered double hydroxides |journal=J Pharm Sci |volume=94 |issue=5 |pages=1135–48 |date=May 2005 |pmid=15793807 |doi=10.1002/jps.20336 }} In 2008, a United States patent was issued for the utilization of ibuprofenate complexes (including copper ibuprofenate) as a wood preservative.{{US patent reference

| number = 7462227

| issue-date = 2007-07-26

| inventor = Anderson, Albert Gordon; Feaster, John; Patel, Damini; Scialdone, Mark

| title = Ibuprofen complexes as wood preservatives

}}