Coprostane

{{short description|Steroid chemical compound}}

{{chembox

| Name =

| ImageFile = 5β-Cholestane.svg

| ImageSize =

| ImageAlt =

| ImageFile1 = 5Beta-Cholestane molecule ball.png

| ImageSize1 = 260

| ImageAlt1 = Ball-and-stick model of the coprostane molecule

| IUPACName = 5β-Cholestane

| SystematicName = (1R,3aS,3bR,5aS,9aS,9bS,11aR)-9a,11a-Dimethyl-1-[(2R)-6-methylheptan-2-yl]hexadecahydro-1H-cyclopenta[a]phenanthrene

| OtherNames =

|Section1={{Chembox Identifiers

| SMILES = C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@H]4[C@@]3(CCCC4)C)C

| PubChem = 5283630

| ChemSpiderID_Ref =

| ChemSpiderID = 4446724

| UNII = 6P255N992E

| ChEBI = 35517

| Beilstein = 2051807

| StdInChI_Ref =

| StdInChI = 1S/C27H48/c1-19(2)9-8-10-20(3)23-14-15-24-22-13-12-21-11-6-7-17-26(21,4)25(22)16-18-27(23,24)5/h19-25H,6-18H2,1-5H3/t20-,21+,22+,23-,24+,25+,26+,27-/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = XIIAYQZJNBULGD-CJPSHIORSA-N

| CASNo_Ref =

| CASNo = 481-20-9

}}

|Section2={{Chembox Properties

| C=27|H=48

| Appearance =

| Density =

| Solubility =

| MeltingPtC =

| BoilingPt =

}}

|Section7={{Chembox Hazards

| ExternalSDS =

| MainHazards =

| FlashPt =

}}

|Section8={{Chembox Related

| OtherFunction_label = Stanols

| OtherFunction = 24-ethyl coprostanol
coprostanol

}}

}}

Coprostane, also known as 5β-cholestane, is a sterane and a parent compound of a variety of steroid derivatives, such as ecdysone and coprostanol.{{cite journal|last=D'Anjou|first=R.M.|author2=Bradley, R.S. |author3=Balascio, N.L. |author4=Finkelstein, D.B. |title=Climate impacts on human settlement and agricultural activities in northern Norway revealed through sediment biogeochemistry|journal=PNAS|date=December 2012|volume=109|issue=50|pages=20332–20337|doi=10.1073/pnas.1212730109|url=http://www.pnas.org/content/early/2012/11/21/1212730109.full.pdf |pmid=23185025 |pmc=3528558|bibcode=2012PNAS..10920332D |doi-access=free}}