Corticotropin-like intermediate peptide

{{infobox protein

| Name = pro-opiomelanocortin

| caption =

| image = Corticotropin-like intermediate peptide.svg

| width =

| HGNCid = 9201

| Symbol = POMC

| AltSymbols =

| EntrezGene = 5443

| OMIM = 176830

| RefSeq = NM_000939

| UniProt = P01189

| PDB =

| ECnumber =

| Chromosome = 2

| Arm = p

| Band = 23

| LocusSupplementaryData =

}}

{{Chembox

| ImageFile = Corticotropin-like intermediate peptide.svg

| ImageSize =

| IUPACName = L-arginyl-L-prolyl-L-valyl-L-lysyl-L-valyl-L-tyrosyl-L-prolyl-L-asparaginyl-L-glycyl-L-alanyl-L-α-glutamyl-L-α-aspartyl-L-α-glutamyl-L-seryl-L-alanyl-L-α-glutamyl-L-alanyl-L-phenylalanyl-L-prolyl-L-leucyl-L-α-glutamyl-L-phenylalanine

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 53917-42-3

| PubChem = 102307347

| ChemSpiderID = 14195066

| SMILES = C[C@@H](C(=N[C@@H](CCC(=O)O)C(=N[C@@H](CC(=O)O)C(=N[C@@H](CCC(=O)O)C(=N[C@@H](CO)C(=N[C@@H](C)C(=N[C@@H](CCC(=O)O)C(=N[C@@H](C)C(=N[C@@H](CC1=CC=CC=C1)C(=O)N2CCC[C@H]2C(=N[C@@H](CC(C)C)C(=N[C@@H](CCC(=O)O)C(=N[C@@H](CC3=CC=CC=C3)C(=O)O)O)O)O)O)O)O)O)O)O)O)O)N=C(CN=C([C@H](CC(=N)O)N=C([C@@H]4CCCN4C(=O)[C@H](CC5=CC=C(C=C5)O)N=C([C@H](C(C)C)N=C([C@H](CCCCN)N=C([C@H](C(C)C)N=C([C@@H]6CCCN6C(=O)[C@H](CCCNC(=N)N)N)O)O)O)O)O)O)O

| InChIKey = ZYDMZKPAPSZILB-UHFFFAOYAN

| StdInChI = 1S/C112H165N27O36/c1-56(2)48-72(100(163)125-70(37-41-86(148)149)97(160)133-77(111(174)175)51-63-24-14-11-15-25-63)129-103(166)79-28-20-46-138(79)109(172)75(49-62-22-12-10-13-23-62)131-93(156)61(9)121-95(158)68(35-39-84(144)145)123-92(155)60(8)122-102(165)78(55-140)134-98(161)71(38-42-87(150)151)126-101(164)74(53-88(152)153)128-96(159)69(36-40-85(146)147)124-91(154)59(7)120-83(143)54-119-94(157)73(52-82(115)142)130-104(167)80-29-21-47-139(80)110(173)76(50-64-31-33-65(141)34-32-64)132-107(170)89(57(3)4)135-99(162)67(27-16-17-43-113)127-106(169)90(58(5)6)136-105(168)81-30-19-45-137(81)108(171)66(114)26-18-44-118-112(116)117/h10-15,22-25,31-34,56-61,66-81,89-90,140-141H,16-21,26-30,35-55,113-114H2,1-9H3,(H2,115,142)(H,119,157)(H,120,143)(H,121,158)(H,122,165)(H,123,155)(H,124,154)(H,125,163)(H,126,164)(H,127,169)(H,128,159)(H,129,166)(H,130,167)(H,131,156)(H,132,170)(H,133,160)(H,134,161)(H,135,162)(H,136,168)(H,144,145)(H,146,147)(H,148,149)(H,150,151)(H,152,153)(H,174,175)(H4,116,117,118)/t59-,60-,61-,66-,67-,68-,69-,70-,71-,72-,73-,74-,75-,76-,77-,78-,79-,80-,81-,89-,90-/m0/s1

| StdInChIKey = ZYDMZKPAPSZILB-WKNDHWIVSA-N

}}

|Section2={{Chembox Properties

| C = 112 | H = 165 | N = 27 | O = 36

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Corticotropin-like intermediate [lobe] peptide (CLIP), also known as adrenocorticotropic hormone fragment 18-39 (ACTH(18-39)), is a naturally occurring, endogenous neuropeptide with a docosapeptide structure and the amino acid sequence Arg-Pro-Val-Lys-Val-Tyr-Pro-Asn-Gly-Ala-Glu-Asp-Glu-Ser-Ala-Glu-Ala-Phe-Pro-Leu-Glu-Phe. CLIP is generated as a proteolyic cleavage product of adrenocorticotropic hormone (ACTH),{{cite journal |vauthors=Gianoulakis C, Seidah NG, Routhier R, Chrétien M | title = Biosynthesis and characterization of adrenocorticotropic hormone, alpha-melanocyte-stimulating hormone, and an NH2-terminal fragment of the adrenocorticotropic hormone/beta-lipotropin precursor from rat pars intermedia | journal = The Journal of Biological Chemistry | volume = 254 | issue = 23 | pages = 11903–6 |date=December 1979 | doi = 10.1016/S0021-9258(19)86402-5 | pmid = 227883 | url = http://www.jbc.org/cgi/pmidlookup?view=long&pmid=227883| doi-access = free }}{{cite book | author = Lloyd D. Fricker | title = Peptide biosynthesis and processing | url = https://books.google.com/books?id=cvvW1e3T__sC&pg=PA78 | access-date = 25 November 2011 | date = 24 July 1991 | publisher = CRC Press | isbn = 978-0-8493-8852-1 | pages = 78}} which in turn is a cleavage product of proopiomelanocortin (POMC).{{cite book | author1 = Anthony W. Norman | author2 = Gerald Litwack | title = Hormones | url = https://archive.org/details/hormones00norm | url-access = registration | access-date = 25 November 2011 | date = 26 September 1997 | publisher = Academic Press | isbn = 978-0-12-521441-4 | pages = [https://archive.org/details/hormones00norm/page/12 12]}} Its physiological role has been investigated in various tissues,{{cite journal |vauthors=Marshall JB, Kapcala LP, Manning LD, McCullough AJ | title = Effect of corticotropin-like intermediate lobe peptide on pancreatic exocrine function in isolated rat pancreatic lobules | journal = The Journal of Clinical Investigation | volume = 74 | issue = 5 | pages = 1886–9 |date=November 1984 | pmid = 6209301 | pmc = 425369 | doi = 10.1172/JCI111608 }}{{cite journal |vauthors=Zaphiropoulos A, Charnay Y, Vallet P, Constantinidis J, Bouras C | title = Immunohistochemical distribution of corticotropin-like intermediate lobe peptide (CLIP) immunoreactivity in the human brain | journal = Brain Research Bulletin | volume = 26 | issue = 1 | pages = 99–111 |date=January 1991 | pmid = 1849784 | doi = 10.1016/0361-9230(91)90194-O| s2cid = 556547 }} specifically in the central nervous system.{{cite book | author1 = Shojiro Inoué | author2 = Shojiro Inoué | title = Biology of sleep substances | url = https://books.google.com/books?id=rT7clpjUwaEC&pg=PA136 | access-date = 25 November 2011 | year = 1989 | publisher = CRC Press | isbn = 978-0-8493-4822-8 | pages = 136}}{{cite journal |vauthors=Chastrette N, Cespuglio R, Jouvet M | title = Proopiomelanocortin (POMC)-derived peptides and sleep in the rat. Part 1--Hypnogenic properties of ACTH derivatives | journal = Neuropeptides | volume = 15 | issue = 2 | pages = 61–74 |date=February 1990 | pmid = 1981927 | doi = 10.1016/0143-4179(90)90042-w| s2cid = 41264103 }}{{cite journal |vauthors=Chastrette N, Cespuglio R, Lin YL, Jouvet M | title = Proopiomelanocortin (POMC)-derived peptides and sleep in the rat. Part 2--Aminergic regulatory processes | journal = Neuropeptides | volume = 15 | issue = 2 | pages = 75–88 |date=February 1990 | pmid = 1964203 | doi = 10.1016/0143-4179(90)90043-x| s2cid = 13731355 }}{{cite journal |vauthors=Grigoriev VV, Petrova LN, Ivanova TA, Gabreliyan AV, Serkova TP | title = Effect of corticotropin-like intermediate lobe peptide on presynaptic and postsynaptic glutamate receptors and postsynaptic GABA receptors in rat brain | journal = Bulletin of Experimental Biology and Medicine | volume = 147 | issue = 3 | pages = 319–22 |date=March 2009 | pmid = 19529852 | doi = 10.1007/s10517-009-0499-x| s2cid = 29237407 }}{{cite journal |vauthors=Seidenbecher T, Balschun D, Vogel D, Reymann KG | title = Neuronal transmission of hippocampal CA1 neurones is modulated by corticotropin-like intermediate lobe peptide [CLIP; ACTH(18-39)] | journal = Peptides | volume = 14 | issue = 6 | pages = 1221–4 | year = 1993 | pmid = 8134304 | doi = 10.1016/0196-9781(93)90179-K| s2cid = 7935999 }}

It has been suggested to function as an insulin secretagogue in the pancreas.{{Cite journal |last1=Marshall |first1=J. B. |last2=Kapcala |first2=L. P. |last3=Manning |first3=L. D. |last4=McCullough |first4=A. J. |date=November 1984 |title=Effect of corticotropin-like intermediate lobe peptide on pancreatic exocrine function in isolated rat pancreatic lobules |journal=The Journal of Clinical Investigation |volume=74 |issue=5 |pages=1886–1889 |doi=10.1172/JCI111608 |issn=0021-9738 |pmid=6209301|pmc=425369 }}

References

{{Reflist}}