Cucurbalsaminol A

{{Chembox

| verifiedrevid = 443545226

| ImageFile = Cucurbalsaminol A.svg

| ImageSize =

| ImageAlt =

| IUPACName = (23E)-9-Methyl-19-nor-9β,10α-lanosta-5,23-diene-3β,7β,12β,25-tetrol

| SystematicName = (1R,3aS,3bR,4S,7S,9aS,9bS,11R,11aR)-1-[(2R,4E)-6-Hydroxy-6-methylhept-4-en-2-yl]-3a,6,6,9b,11a-pentamethyl-2,3,3a,3b,4,6,7,8,9,9a,9b,10,11,11a-tetradecahydro-1H-cyclopenta[a]phenanthrene-4,7,11-triol

| OtherNames = Cucurbita-(5,23E)-diene-3β,12β,25-triol; (3β,7β,9β,10α,12β,23E)-4,4,9,14-tetramethyl-19-norcholesta-5,23-diene-3,7,12,23-diol

| Section1 = {{Chembox Identifiers

| CASNo = 1189131-54-1

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = DK3RVK3UAD

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1077876

| PubChem = 44607278

| SMILES = C[C@H](C/C=C/C(O)(C)C)[C@@]1([H])CC[C@@]2(C)[C@]3([H])[C@@H](O)C=C4C(C)(C)[C@@H](O)CC[C@@]4([H])[C@]3(C)C[C@@H](O)[C@@]21C

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 24531940

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI=1S/C30H50O4/c1-18(10-9-14-26(2,3)34)19-13-15-29(7)25-22(31)16-21-20(11-12-23(32)27(21,4)5)28(25,6)17-24(33)30(19,29)8/h9,14,16,18-20,22-25,31-34H,10-13,15,17H2,1-8H3/b14-9+/t18-,19-,20-,22+,23+,24-,25-,28+,29+,30+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = WFULNIMUTJQIKF-HCLZVIJHSA-N

}}

| Section2 = {{Chembox Properties

| C=30 | H=50 | O=4

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Cucurbalsaminol A or cucurbita-5,23(E)-diene-3β,12β,25-triol, is a chemical compound with formula {{chem|C|30|H|50|O|4}}, found in the Balsam apple vine (Momordica balsamina). It is a cucurbitane-type triterpenoid, related to cucurbitacin, isolated by C. Ramalhete and others in 2009.{{cite journal |author1=Cátia Ramalhete |author2=Tayyab A. Mansoor |author3=Silva Mulhovo |author4=Joseph Molnár |author5=Maria-José U. Ferreira | year = 2009 | pages = 2009–2013 | issue = 11 | title = Cucurbitane-Type Triterpenoids from the African Plant Momordica balsamina | volume = 72 | pmid = 19795842 | journal = Journal of Natural Products | doi = 10.1021/np900457u| hdl = 10884/1322 | hdl-access = free }}

Cucurbalsaminol A is an amorphous powder soluble in methanol and ethyl acetate but insoluble in n-hexane. Unlike Cucurbalsaminol B, it is not cytotoxic.