Cyclarbamate

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = Cyclopentane-1,1-diyldimethanediyl bis(phenylcarbamate)

| image = Cyclarbamate.svg

| image_class = skin-invert-image

| CAS_number = 5779-54-4

| ATC_prefix = None

| ATC_suffix =

| UNII = 779291866J

| PubChem = 72076

| ChemSpiderID = 65062

| ChEMBL = 2104142

| C = 21 | H = 24 | N = 2 | O = 4

| smiles = O=C(OCC1(CCCC1)COC(=O)Nc2ccccc2)Nc3ccccc3

| synonyms = BSM-906M

| StdInChI = 1S/C21H24N2O4/c24-19(22-17-9-3-1-4-10-17)26-15-21(13-7-8-14-21)16-27-20(25)23-18-11-5-2-6-12-18/h1-6,9-12H,7-8,13-16H2,(H,22,24)(H,23,25)

| StdInChIKey = IRZVVDMCEZNNCW-UHFFFAOYSA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_category =

| legal_AU =

| legal_BR = C1

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}

| legal_CA =

| legal_DE =

| legal_NZ =

| legal_UK =

| legal_US =

| legal_EU =

| legal_UN =

| legal_status = Rx-only

| routes_of_administration =

}}

Cyclarbamate (INN; Casmalon), also known as cyclopentaphene, is a muscle relaxant and tranquilizer of the carbamate family which has been marketed by Cassenne in France since 1961.{{cite book | author = William Andrew Publishing | title = Pharmaceutical manufacturing encyclopedia | url = https://books.google.com/books?id=TIu28TH_iAYC&pg=PA1155 | access-date = 26 November 2011 | year = 2007 | publisher = Elsevier | isbn = 978-0-8155-1526-5 | pages = 1155}}{{cite web | url = http://whqlibdoc.who.int/hq/2004/WHO_EDM_QSM_2004.5.pdf | author = World Health Organization | title = The use of stems in the selection of International Nonproprietary Names (INN) for pharmaceutical substance | date = 2004 }}{{cite journal | vauthors = Gaultier M, Leperchey F | title = [Preliminary data on the use in clinical practice of cyclarbamate (N,N-diphenyl dicarbamate of 1,1-cyclopentanedimethanol] | language = French | journal = La Presse Médicale | volume = 70 | issue = | pages = 863–4 | date = April 1962 | pmid = 13897295 | doi = | url = }}