Cyclobarbital

{{Short description|Barbiturate}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 460109682

| IUPAC_name = 5-(1-cyclohexenyl)-5-ethyl-1,3-diazinane-2,4,6-trione

| image = Cyclobarbital.svg

| image_class = skin-invert-image

| width = 100

| image2 = Cyclobarbital ball-and-stick.png

| image_class2 = bg-transparent

| width2 = 180

| Drugs.com = {{Drugs.com|international|cyclobarbital}}

| tradename =

| pregnancy_category =

| legal_BR = B1

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}

| legal_CA = Schedule IV

| legal_DE = Anlage II

| legal_UK = Class B

| legal_UN = P III

| routes_of_administration = Oral (tablets)

| bioavailability =

| metabolism = Hepatic

| elimination_half-life =

| excretion = Renal

| index2_label = calcium

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 52-31-3

| CAS_number2_Ref = {{cascite|correct|CAS}}

| CAS_number2 = 143-76-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0M8A98AD9H

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII2 = 0HZN7FV25R

| ATC_prefix = N05

| ATC_suffix = CA10

| PubChem = 5838

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 5632

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = D07323

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 268164

| C=12 | H=16 | N=2 | O=3

| smiles = O=C1NC(=O)NC(=O)C1(/C2=C/CCCC2)CC

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C12H16N2O3/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16/h6H,2-5,7H2,1H3,(H2,13,14,15,16,17)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = WTYGAUXICFETTC-UHFFFAOYSA-N

}}

Cyclobarbital, cyclobarbitol, or cyclobarbitone refer to a barbiturate derivative.{{cite journal | vauthors = Breimer DD, Winten MA | title = Pharmacokinetics and relative bioavailability of cyclobarbital calcium in man after oral administration | journal = European Journal of Clinical Pharmacology | volume = 09 | issue = 5–6 | pages = 443–50 | date = March 1976 | pmid = 989475 | doi = 10.1007/bf00606563 | s2cid = 20271169 }}

It was available in Russia as a fixed-dose combination of 100mg cyclobarbital and 10mg diazepam under the brand name Reladorm, indicated for the treatment of insomnia, but was discontinued in 2019.