Cyclohexylthiophthalimide
{{chembox
| Name=cyclohexylthiophthalimide
| verifiedrevid = 444020789
| Reference =
| ImageFile =Cyclohexylthiophthalimid.svg
| ImageSize =200px
| PIN = 2-(Cyclohexylsulfanyl)-1H-isoindole-1,3(2H)-dione
| OtherNames =
|Section1={{Chembox Identifiers
| Abbreviations = CTP
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 17796-82-6
| EINECS = 2417741
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 50Z9596NJ3
| PubChem = 28777
| ChemSpiderID = 26768
| SMILES = O=C3c1ccccc1C(=O)N3SC2CCCCC2
| InChI = 1/C14H15NO2S/c16-13-11-8-4-5-9-12(11)14(17)15(13)18-10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7H2
| InChIKey = UEZWYKZHXASYJN-UHFFFAOYAT
| StdInChI = 1S/C14H15NO2S/c16-13-11-8-4-5-9-12(11)14(17)15(13)18-10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7H2
| StdInChIKey = UEZWYKZHXASYJN-UHFFFAOYSA-N
}}
|Section2={{Chembox Properties
| C=14|H=15|N=1|O=2|S=1
| Appearance = Colourless solid
| MeltingPtC = 90
}}
|Section7={{Chembox Hazards
}}
|Section8={{Chembox Related
| OtherFunction_label =
| OtherFunction =
}}
}}
Cyclohexylthiophthalimide (abbreviated CTP) is an organosulfur compound that is used in production of rubber. It is a white solid, although commercial samples often appear yellow. It features the sulfenamide functional group, being a derivative of phthalimide and cyclohexanethiol.Hans-Wilhelm Engels, Herrmann-Josef Weidenhaupt, Manfred Pieroth, Werner Hofmann, Karl-Hans Menting, Thomas Mergenhagen, Ralf Schmoll, Stefan Uhrlandt “Rubber, 4. Chemicals and Additives” in Ullmann's Encyclopedia of Industrial Chemistry, 2004, Wiley-VCH, Weinheim. {{doi|10.1002/14356007.a23_365.pub2}} In the production of synthetic rubber, CTP impedes the onset of sulfur vulcanization.