Cyclopentobarbital

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 399738699

| IUPAC_name = 5-(1-cyclopent-2-enyl)-5-prop-2-enyl-1,3-
diazinane-2,4,6-trione

| image = Cyclopal.svg

| width = 120

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA = Schedule IV

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 76-68-6

| CAS_supplemental =
302-34-1 (sodium salt)

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2230XWG55Q

| ATC_prefix = None

| ATC_suffix =

| PubChem = 6454

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 6212

| C=12 | H=14 | N=2 | O=3

| smiles = O=C1NC(=O)NC(=O)C1(C2/C=C\CC2)C\C=C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C12H14N2O3/c1-2-7-12(8-5-3-4-6-8)9(15)13-11(17)14-10(12)16/h2-3,5,8H,1,4,6-7H2,(H2,13,14,15,16,17)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = XOVJAYNMQDTIJD-UHFFFAOYSA-N

| synonyms = Allylpental, Cyclopental, 5-Allyl-5-Δ²-Cyclopentenyl Barbituric Acid

}}

Cyclopentobarbital sodium (Cyclopal, Dormisan) is a barbiturate derivative invented in the 1940s.{{cite book | vauthors = Martin JR, Godel T, Hunkeler W, Jenck F, Moreau JL, Sleight AJ, Widmer U | chapter = Psychopharmacological agents. | title = Kirk-Othmer Encyclopedia of Chemical Technology | date = December 2000 | doi = 10.1002/0471238961.1619250313011820.a01 | isbn = 0471238961 }} It has sedative and anticonvulsant properties, and was used primarily as an anaesthetic in veterinary medicine.{{cite journal | vauthors = Vander Brook MJ, Cartland GF | title = A Pharmacologic Study of 5-Allyl-5-Cyclopentenyl Barbituric Acid (Cyclopal). | journal = Journal of Pharmacology and Experimental Therapeutics | date = 1944 | volume = 80 | issue = 2 | pages = 119–125 | citeseerx = 10.1.1.983.6071 }} Cyclopal is considered similar in effects to phenobarbital but lasts almost three times as long, and is considered a long-acting barbiturate with a fairly slow onset of action.