Cyclopregnol

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name =

| image = Cyclopregnol.svg

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 465-53-2

| CAS_supplemental =

| class =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 12308830

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 35517184

| UNII = Z06494074X

| KEGG =

| ChEBI =

| ChEMBL =

| C=21 | H=32 | O=2

| SMILES = CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2C[C@H]([C@]45[C@@]3(CC[C@H]4C5)C)O)C

| StdInChI_Ref =

| StdInChI = 1S/C21H32O2/c1-12(22)15-4-5-16-14-10-18(23)21-11-13(21)6-9-20(21,3)17(14)7-8-19(15,16)2/h13-18,23H,4-11H2,1-3H3/t13-,14-,15+,16-,17-,18+,19+,20+,21+/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = UGIARLNNAPRCPF-HUPPADNKSA-N

| synonyms = Neurosterone; 6β-Hydroxy-3:5-cyclopregnan-20-one

}}

Cyclopregnol (INN), also known as neurosterone, as well as 6β-hydroxy-3:5-cyclopregnan-20-one, is a synthetic pregnane steroid which was developed in the 1950s as a "psychotropic agent" for the treatment of mental disorders but was never marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA646|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=646–}}{{cite journal| vauthors = Patel DK, Petrow V, Stuart-Webb IA | title=133. 6β-Hydroxy-3 : 5-cyclopregnan-20-one and some related compounds|journal=J. Chem. Soc.|year=1957|pages=665–668|issn=0368-1769|doi=10.1039/JR9570000665}}{{cite journal | vauthors = Hardwick SW, Pearse JJ, Petrow V | title = 6 beta-Hydroxy-3:5-cyclopregnan-20-one in mental states | journal = The Journal of Mental Science | volume = 103 | issue = 433 | pages = 835–839 | date = October 1957 | pmid = 13481595 | doi = 10.1192/bjp.103.433.835 }}{{cite journal | vauthors = Loranger AW | title = Treatment of acute mental disorders with an adrenal steroid | journal = The British Journal of Psychiatry | volume = 114 | issue = 512 | pages = 843–844 | date = July 1968 | pmid = 4874165 | doi = 10.1192/bjp.114.512.843 | s2cid = 45608631 }} Although an initial small clinical study found effectiveness, a subsequent, larger and more rigorous study found that cyclopregnol was no more effective than placebo and was clearly inferior to chlorpromazine.{{cite book | vauthors = Pachter IJ, Rubin AA | chapter = Antipyschotic and Anti-anxiety Agents | veditors = Childress SJ D|title=Annual Reports in Medicinal Chemistry| chapter-url = https://books.google.com/books?id=rDUMWpvOgjkC&pg=PA3|year=1969|publisher=Academic Press|isbn=978-0-08-058348-8|pages=3–}}