DBDMH
{{chembox
| Verifiedimages = changed
| Watchedfields = changed
| verifiedrevid = 399740402
| Name = 1,3-Dibromo-5,5-Dimethylhydantoin
| ImageFileL1_Ref = {{chemboximage|correct|??}}
| ImageFileL1 = DBDMH.png
| ImageSizeL1 = 120px
| ImageAltL1 = Skeletal formula of DBDMH
| ImageFileR1 = DBDMH 3D ball.png
| ImageSizeR1 = 130
| ImageAltR1 = Ball-and-stick model of the DBDMH molecule
| PIN = 1,3-Dibromo-5,5-dimethylimidazolidine-2,4-dione
| OtherNames = DBDMH, Dibromantin, Dibromodimethylhydantoin
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 6234
| InChI = 1/C5H6Br2N2O2/c1-5(2)3(10)8(6)4(11)9(5)7/h1-2H3
| InChIKey = VRLDVERQJMEPIF-UHFFFAOYAQ
| SMILES = O=C1N(Br)C(=O)N(Br)C1(C)C
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = V9R5F9I7MZ
| PubChem = 6479
| EC_number = 201-030-9
| ChEMBL = 3184055
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C5H6Br2N2O2/c1-5(2)3(10)8(6)4(11)9(5)7/h1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = VRLDVERQJMEPIF-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 77-48-5
}}
|Section2={{Chembox Properties
| C =5|H=6|Br=2|N=2|O=2
| Appearance = White solid
| Density = 1.36 g/cm3
| Solubility = 0.1 g/100 mL (20 °C)
| MeltingPtC = 197 to 203
| MeltingPt_notes =
| BoilingPt =
}}
|Section7={{Chembox Hazards
| ExternalSDS =
| GHSPictograms = {{GHS05}}{{GHS06}}{{GHS07}}{{GHS09}}
| GHSSignalWord = Danger
| HPhrases = {{H-phrases|301|302|314|317|319|410}}
| PPhrases = {{P-phrases|260|261|264|270|272|273|280|301+310|301+312|301+330+331|302+352|303+361+353|304+340|305+351+338|310|321|330|333+313|337+313|363|391|405|501}}
}}
}}
DBDMH (also known as 1,3-Dibromo-5,5-Dimethylhydantoin) is an organic compound derived from the heterocycle called dimethylhydantoin. This white crystalline compound with a slight bromine odor is widely used as a disinfectant used for drinking water purification, recreational water treatment, as a bleaching agent in pulp and paper mills, and for treating industrial/commercial water cooling systems. David Ioffe, Arieh Kampf "Bromine, Organic Compounds" in Kirk-Othmer Encyclopedia of Chemical Technology, 2002, by John Wiley & Sons. {{doi| 10.1002/0471238961.0218151325150606.a01}} Its action does not involve the use of hypochlorous acid.
Mechanism of action
1,3-Dibromo-5,5-Dimethylhydantoin is a source of bromine, which is equivalent to hypobromous acid (HOBr).
:Br2X + 2 H2O → 2 HOBr + H2X
(Where H2X is 5,5-dimethylhydantoin)
With a pKa of 8.6, hypobromous acid partially dissociates in water:
:HOBr ⇌ H+ + BrO−
Hypobromous acid serves as a source of "Br+," which produces bromide ions in the process of disinfection:
:HOBr + live pathogens → Br− + dead pathogens
The resulting bromide ions can then undergo oxidation to hypobromous acid in the presence of an oxidizer of sufficient strength e.g. ozone, hypochlorous acid, potassium monopersulfate. This reoxidation process is commonly called "activation" of the bromide ion:
:Br− + HOCl → HOBr + Cl−
References
External links
- [http://www.sigmaaldrich.com/MSDS/MSDS/PleaseWaitMSDSPage.do?language=&country=IE&brand=ALDRICH&productNumber=157902&PageToGoToURL=http://www.sigmaaldrich.com/catalog/product/aldrich/157902?lang=en®ion=IE MSDS]