DBL-583

{{Short description|Selective dopamine reuptake inhibitor of the piperazine chemical class}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 449575636

| IUPAC_name =

| image = DBL-583.svg

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 184713-57-3

| ATC_prefix =

| ATC_suffix =

| PubChem = 9960697

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 8136304

| ChEMBL = 341692

| C=38 | H=50 | F=2 | N=2 | O=3

| smiles = CCCCCCCCCC(=O)OC(CCN1CCN(CC1)CCOC(C2=CC=C(C=C2)F)C3=CC=C(C=C3)F)C4=CC=CC=C4

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C38H50F2N2O3/c1-2-3-4-5-6-7-11-14-37(43)45-36(31-12-9-8-10-13-31)23-24-41-25-27-42(28-26-41)29-30-44-38(32-15-19-34(39)20-16-32)33-17-21-35(40)22-18-33/h8-10,12-13,15-22,36,38H,2-7,11,14,23-30H2,1H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = IXQPQADYPIEKQC-UHFFFAOYSA-N

| molecular_weight =

}}

DBL-583 is a selective dopamine reuptake inhibitor of the piperazine chemical class.{{cite journal | vauthors = Baumann MH, Phillips JM, Ayestas MA, Ali SF, Rice KC, Rothman RB | title = Preclinical evaluation of GBR12909 decanoate as a long-acting medication for methamphetamine dependence | journal = Annals of the New York Academy of Sciences | volume = 965 | issue = 1| pages = 92–108 | date = June 2002 | pmid = 12105088 | doi = 10.1111/j.1749-6632.2002.tb04154.x | bibcode = 2002NYASA.965...92B | s2cid = 27275723 }} It is the decanoate ester of a hydroxy vanoxerine. DBL-583 breaks down very slowly in the body, lasting for up to a month after a single injection.