DIDS

{{Chembox

| ImageFile = DIDS.svg

| ImageSize = 240

| ImageAlt = Skeletal formula

| ImageFile1 = DIDS-3D-balls.png

| ImageSize1 = 240

| ImageAlt1 = Ball-and-stick model

| PIN = 2,2′-(Ethene-1,2-diyl)bis(5-isothiocyanatobenzene-1-sulfonic acid)

| OtherNames = 5-Isothiocyanato-2-[2-(4-isothiocyanato-2-sulfophenyl)ethenyl]benzenesulfonic acid

|Section1={{Chembox Identifiers

| IUPHAR_ligand = 4177

| Abbreviations = DIDS

| CASNo = 53005-05-3

| CASNo_Comment = (E)

| CASNo_Ref = {{cascite|correct|??}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = QHR3Z2PN8M

| UNII_Comment = (E)

| PubChem = 40600

| PubChem1 = 5281951

| PubChem1_Comment = (E)

| PubChem2 = 9548709

| PubChem2_Comment = (Z)

| ChemSpiderID = 37094

| ChemSpiderID_Ref = {{Chemspidercite|correct|ChemSpider}}

| ChemSpiderID1 = 4445228

| ChemSpiderID1_Comment = (E)

| ChemSpiderID1_Ref = {{Chemspidercite|correct|ChemSpider}}

| ChemSpiderID2 = 7827632

| ChemSpiderID2_Comment = (Z)

| ChemSpiderID2_Ref = {{Chemspidercite|correct|ChemSpider}}

| KEGG = C11591

| MeSHName = 4,4'-Diisothiocyanostilbene-2,2'-disulfonic+acid

| ChEBI = 36511

| SMILES = OS(=O)(=O)C1=C(C=CC2=C(C=C(C=C2)N=C=S)S(O)(=O)=O)C=CC(=C1)N=C=S

| StdInChI = 1S/C16H10N2O6S4/c19-27(20,21)15-7-13(17-9-25)5-3-11(15)1-2-12-4-6-14(18-10-26)8-16(12)28(22,23)24/h1-8H,(H,19,20,21)(H,22,23,24)

| StdInChIKey = YSCNMFDFYJUPEF-UHFFFAOYSA-N

| Beilstein = 6543839}}

|Section2={{Chembox Properties

| C=16 | H=10 | N=2 | O=6 | S=4

| MeltingPtC = 400

| LogP = 4.72

| pKa = −3.21, −1.428, −0.37, 0.23

| pKb = 13.77, 14.37, 15.425, 17.21}}

}}

4,4′-Diisothiocyano-2,2′-stilbenedisulfonic acid (DIDS) is an anion exchange inhibitor,{{citation

| last1 = Jessen | first1 = Flemming

| year = 1986

| title = Identification of the anion exchange protein of ehrlich cells: A kinetic analysis of the inhibitory effects of 4,4′-diisothiocyano-2,2′-stilbene-disulfonic acid (DIDS) and labeling of membrane proteins with3H-DIDS

| journal = Journal of Membrane Biology

| volume = 92

| doi = 10.1007/BF01869388

| pmid = 3783658

| last2 = Sjøholm

| first2 = C

| last3 = Hoffmann

| first3 = EK

| issue = 3

| pages = 195–205

| s2cid = 19244281

}} blocking reversibly, and later irreversibly, exchangers such as chloride-bicarbonate exchanger.{{citation

| last1 = Lane | first1 = Michelle

| last2 = Baltz | first2 = Jay M.

| last3 = Bavister | first3 = Barry D.

| year = 1999

| title = Bicarbonate/Chloride Exchange Regulates Intracellular pH of Embryos but Not Oocytes of the Hamster

| journal = Biology of Reproduction

| volume = 61

| issue = 2

| pages = 452–457

| doi = 10.1095/biolreprod61.2.452

| pmid = 10411526

| doi-access = free

}}