DMG-PEG 2000
{{Chembox
| ImageFile = DMG-PEG 2000.svg
| ImageSize =
| ImageAlt =
| IUPACName = 1,2-Dimyristoyl-sn-glycero-3-methoxypolyethylene glycol
| OtherNames = PEG-DMG
| Section1 =
{{Chembox Identifiers
| 3DMet =
| Abbreviations =
| Beilstein =
| CASNo = 1397695-86-1
| CASNo_Comment =
| ChEBI =
| ChemSpiderID = 98644331
| EINECS =
| Gmelin =
| InChI = InChI=1S/C122H242O50/c1-4-6-8-10-12-14-16-18-20-22-24-26-121(123)171-119-120(172-122(124)27-25-23-21-19-17-15-13-11-9-7-5-2)118-170-117-116-169-115-114-168-113-112-167-111-110-166-109-108-165-107-106-164-105-104-163-103-102-162-101-100-161-99-98-160-97-96-159-95-94-158-93-92-157-91-90-156-89-88-155-87-86-154-85-84-153-83-82-152-81-80-151-79-78-150-77-76-149-75-74-148-73-72-147-71-70-146-69-68-145-67-66-144-65-64-143-63-62-142-61-60-141-59-58-140-57-56-139-55-54-138-53-52-137-51-50-136-49-48-135-47-46-134-45-44-133-43-42-132-41-40-131-39-38-130-37-36-129-35-34-128-33-32-127-31-30-126-29-28-125-3/h120H,4-119H2,1-3H3
| InChIKey = NLDCRRFPGOSAHV-UHFFFAOYSA-N
| KEGG =
| MeSHName =
| PubChem = 122629501
| RTECS =
| SMILES = O=C(CCCCCCCCCCCCC)OCC(OC(CCCCCCCCCCCCC)=O)COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOC
| UNNumber =
}}
| Section2 = {{Chembox Properties
| Formula = {{Chem2|C122H242O50|auto=yes}}
| MolarMass =
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
DMG-PEG 2000 is a synthetic lipid formed by the PEGylation of myristoyl diglyceride. It is used to manufacture lipid nanoparticles that are used in mRNA vaccines,{{cite journal | vauthors = Shirane D, Tanaka H, Nakai Y, Yoshioka H, Akita H | title = Development of an Alcohol Dilution-Lyophilization Method for Preparing Lipid Nanoparticles Containing Encapsulated siRNA | journal = Biological & Pharmaceutical Bulletin | volume = 41 | issue = 8 | pages = 1291–1294 | date = 2018 | pmid = 30068880 | doi = 10.1248/bpb.b18-00208 | doi-access = free }} and in particular forms part of the drug delivery system for the Moderna COVID-19 vaccine.{{cite web | url=https://www.cdc.gov/vaccines/covid-19/info-by-product/moderna/downloads/standing-orders.pdf | title=Moderna COVID-19 Vaccine Standing Orders for Administering Vaccine to Persons 18 Years of Age and Older | publisher=Centers for Disease Control and Prevention (CDC)}}
See also
;Moderna COVID-19 vaccine nanoparticle ingredients