DODC

{{Short description|Chemical compound}}

{{for|the fictional organization|United States Department of Damage Control}}

{{drugbox

| drug_name = DODC

| image = DODC_structure.png

| image_class = skin-invert-image

| legal_UK =

| legal_DE =

| C = 11 | H = 15 | Cl = 2 | N = 1 | O = 2

| IUPAC_name = 1-(2,5-dimethoxy-3,4-dichlorophenyl)propan-2-amine

| CAS_number = 1373918-65-0

| ChemSpiderID =

| PubChem = 168429515

| UNII = JW779U7A4H

| smiles = Clc1c(OC)cc(CC(C)N)c(OC)c1Cl

| StdInChI =

| StdInChIKey =

}}

DODC is a psychedelic drug from the substituted amphetamine family which acts as an agonist of the 5-HT_2A receptor. It is the 3,4-dichloro derivative of the well known psychedelic drug 2,5-Dimethoxy-4-chloroamphetamine (DOC). DODC was first officially published in a patent filed by Gilgamesh Pharmaceuticals in 2020,{{cite patent | url = https://patentscope.wipo.int/search/docs2/pct/WO2022006186/pdf/EqbUUQtI2SbB_GMrGlZKBhu4yVKovRkQUacq5qph470 | inventor = Kruegel AC | title = Phenalkylamines and Methods of Treating Mood Disorders. | country = WO | number = 2022/006186 | assign1 = Gilgamesh Pharmaceuticals | pubdate = January 2022 | postscript = . }} though anecdotal reports suggest it had been synthesised by clandestine chemists and its activity established several years prior to this.