DPDPE
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name = (4S,7S,13S)-13-
| image = DPDPE structure.svg
| width = 250px
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| class =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 88373-73-3
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = HB4QD9GL6F
| CAS_supplemental =
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| PubChem = 104787
| IUPHAR_ligand =
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 94592
| KEGG =
| ChEBI = 73356
| ChEMBL = 31421
| synonyms = L-Tyrosyl-D-penicillamyl-glycyl-L-phenylalanyl-D-penicillamine (2->5)-disulfide; H-Tyr-D-Pen(1)-Gly-Phe-D-Pen(1)-OH
| C=30 | H=39 | N=5 | O=7 | S=2
| SMILES = CC1([C@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(SS1)(C)C)C(=O)O)CC2=CC=CC=C2)NC(=O)[C@H](CC3=CC=C(C=C3)O)N)C
| StdInChI_Ref =
| StdInChI = 1S/C30H39N5O7S2/c1-29(2)23(34-25(38)20(31)14-18-10-12-19(36)13-11-18)27(40)32-16-22(37)33-21(15-17-8-6-5-7-9-17)26(39)35-24(28(41)42)30(3,4)44-43-29/h5-13,20-21,23-24,36H,14-16,31H2,1-4H3,(H,32,40)(H,33,37)(H,34,38)(H,35,39)(H,41,42)/t20-,21-,23-,24-/m0/s1
| StdInChIKey_Ref =
| StdInChIKey = MCMMCRYPQBNCPH-WMIMKTLMSA-N
}}
DPDPE ([{{Small|D}}-{{abbr|Pen|penicillamine}}2,{{Small|D}}-{{abbr|Pen|Penicillamine}}5]enkephalin) is a synthetic opioid peptide and a selective agonist of the δ-opioid receptor (DOR) which is used in scientific research.{{cite book| vauthors = Tseong LF |title=Pharmacology of Opioid Peptides|url=https://books.google.com/books?id=PhHTwIy9Wd8C&pg=PA9|date=1 September 1995|publisher=CRC Press|isbn=978-3-7186-5632-5|pages=9–}} It was developed in the early 1980s and was the first highly selective agonist of the DOR to be developed. It was derived from structural modification of met-enkephalin.{{cite book| vauthors = Kastin A, Kastin AJ |title=Handbook of Biologically Active Peptides|url=https://books.google.com/books?id=n8SV9iM6kT0C&pg=PA1430|date=28 April 2011|publisher=Academic Press|isbn=978-0-08-046379-7|pages=1430–}}
See also
References
{{Reflist}}
{{Opioid receptor modulators}}
Category:Delta-opioid receptor agonists
{{Analgesic-stub}}