DPI-221

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 410884536

| IUPAC_name = 4-((αS)-α-((2S,5R)-2,5-dimethyl-4-(3-fluorobenzyl)-1-piperazinyl)benzyl)-N,N-diethylbenzamide

| image = DPI-221 Structure.svg

| tradename =

| legal_status =

| CAS_number = 519058-15-2

| UNII = X9LJN69TFK

| PubChem = 9891642

| ChemSpiderID = 8067312

| chemical_formula = C31H38FN3O

| molecular_weight = 487.651

| smiles = O=C(N(CC)CC)c1ccc(cc1)[C@@H](N3C[C@H](N(Cc2cc(F)ccc2)C[C@@H]3C)C)c4ccccc4

| StdInChI = 1S/C31H38FN3O/c1-5-33(6-2)31(36)28-17-15-27(16-18-28)30(26-12-8-7-9-13-26)35-21-23(3)34(20-24(35)4)22-25-11-10-14-29(32)19-25/h7-19,23-24,30H,5-6,20-22H2,1-4H3/t23-,24+,30+/m1/s1

| StdInChIKey = KEXJLZMJVOTFOY-QEGDFHJFSA-N

}}

DPI-221 is an opioid drug that is used in scientific research. It is a highly selective agonist for the δ-opioid receptor, which produces fewer convulsions than most drugs from this family.{{cite journal | vauthors = Holt JD, Watson MJ, Chang JP, O'Neill SJ, Wei K, Pendergast W, Gengo PJ, Chang KJ | display-authors = 6 | title = DPI-221 [4-((alpha-s)-alpha-((2s,5r)-2,5-dimethyl-4-(3-fluorobenzyl)-1-piperazinyl)benzyl)-N,N-diethylbenzamide]: a novel nonpeptide delta receptor agonist producing increased micturition interval in normal rats | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 315 | issue = 2 | pages = 601–8 | date = November 2005 | pmid = 16020629 | doi = 10.1124/jpet.105.090498 | s2cid = 97486165 }}

References