DPI-287

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 430786118

| IUPAC_name = 4-[(R)-[(2S,5R)-2,5-dimethyl-4-benzylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N,N-diethylbenzamide

| image = DPI-287.svg

| tradename =

| legal_status =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 519058-13-0

| PubChem = 21025820

| C=31 | H=39 | N=3 | O=2

| smiles = CCN(CC)C(=O)c2ccc(cc2)C(c(ccc4)cc4O)N(CC1C)C(C)CN1Cc3ccccc3

}}

DPI-287 is an opioid drug that is used in scientific research. It is a highly selective agonist for the δ-opioid receptor, which produces less convulsions than most drugs from this family.{{cite journal | vauthors = Jutkiewicz EM | title = The antidepressant-like effects of delta-opioid receptor agonists | journal = Molecular Interventions | volume = 6 | issue = 3 | pages = 162–9 | date = June 2006 | pmid = 16809477 | doi = 10.1124/mi.6.3.7 }} It has antidepressant-like effects.{{cite journal | vauthors = Jutkiewicz EM, Chang KJ, Rice KC, Woods JH | date = 2005 | title = Characterization of a novel nonpeptide delta-opioid agonist analog DPI287 with antidepressant-like activity. | journal = Experimental Biology Meeting Abstracts | number = Abstract # 874.4 }}