DSP-2230

{{Short description|Investigational analgesic drug}}

{{Update|date=October 2024}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (2S)-2-[[[3-cyclobutyl-5-(3,4,5-trifluorophenoxy)-3H-imidazo[4,5-b]pyridin-2-yl]methyl]amino]propanamide

| image = DSP-2230.svg

| image_class = skin-invert-image

| width = 250px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = By mouth

| class =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 1233231-30-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = LSY2D22FBK

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem =

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID =

| KEGG =

| ChEBI =

| ChEMBL = 3545012

| synonyms =

| C=20 | H=20 | F=3 | N=5 | O=2

| SMILES = FC1=CC(OC2=CC=C(N=C3CN([C@@H](C(N([H])[H])=O)C)[H])C(N3C4CCC4)=N2)=CC(F)=C1F

| StdInChI_Ref =

| StdInChI = 1S/C20H20F3N5O2/c1-10(19(24)29)25-9-16-26-15-5-6-17(27-20(15)28(16)11-3-2-4-11)30-12-7-13(21)18(23)14(22)8-12/h5-8,10-11,25H,2-4,9H2,1H3,(H2,24,29)/t10-/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = HHXCJIMPEJSJTG-SNVBAGLBSA-N

}}

DSP-2230 is a selective small-molecule Na_v1.7 and Na_v1.8 voltage-gated sodium channel blocker which is under development by Dainippon Sumitomo Pharma for the treatment of neuropathic pain.{{cite journal | last1 = Martz | first1 = Lauren | name-list-style = vanc | title = Nav-i-gating antibodies for pain | journal = Science-Business EXchange | volume = 7 | issue = 23 | pages = 662 | year = 2014 | issn = 1945-3477 | doi = 10.1038/scibx.2014.662| doi-access = free }}{{cite journal | vauthors = Bagal SK, Chapman ML, Marron BE, Prime R, Storer RI, Swain NA | title = Recent progress in sodium channel modulators for pain | journal = Bioorganic & Medicinal Chemistry Letters | volume = 24 | issue = 16 | pages = 3690–9 | date = August 2014 | pmid = 25060923 | doi = 10.1016/j.bmcl.2014.06.038 | doi-access = free }} As of June 2014, it is in phase I/phase II clinical trials.