DTPMP
{{chembox
| verifiedrevid = 402320280
| ImageFile = DTPMP.png
| PIN= {[(Phosphonomethyl)azanediyl]bis[ethane-2,1-diylnitrilobis(methylene)]}tetrakis(phosphonic acid)
| OtherNames= DTPMPA, Diethylenetriaminepenta(methylene-phosphonic acid)
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 76777
| InChI = 1/C9H28N3O15P5/c13-28(14,15)5-10(1-3-11(6-29(16,17)18)7-30(19,20)21)2-4-12(8-31(22,23)24)9-32(25,26)27/h1-9H2,(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24)(H2,25,26,27)
| InChIKey = DUYCTCQXNHFCSJ-UHFFFAOYAC
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C9H28N3O15P5/c13-28(14,15)5-10(1-3-11(6-29(16,17)18)7-30(19,20)21)2-4-12(8-31(22,23)24)9-32(25,26)27/h1-9H2,(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24)(H2,25,26,27)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = DUYCTCQXNHFCSJ-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo= 15827-60-8
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 0Q75589TM3
| PubChem = 85128
| SMILES = O=P(O)(O)CN(CP(=O)(O)O)CCN(CCN(CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O
}}
|Section2={{Chembox Properties
| C=9 | H=28 | N=3 | O=15 | P=5
| Appearance= Solid
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
DTPMP or diethylenetriamine penta(methylene phosphonic acid) is a phosphonic acid. It has chelating and anti-corrosion properties.{{cite journal | doi = 10.1016/j.scitotenv.2017.09.223 | bibcode = 2018ScTEn.615.1176R | title = Organophosphonates: A review on environmental relevance, biodegradability and removal in wastewater treatment plants | last1 = Rott | first1 = Eduard | last2 = Steinmetz | first2 = Heidrun | last3 = Metzger | first3 = Jörg W. | journal = Science of the Total Environment | date = 2018 | volume = 615 | page = 1176 }}
Properties
DTPMP is normally delivered as salts, because the acid form has very limited solubility in water and tends to crystallize in concentrated aqueous solutions. It is a nitrogenous organic polyphosphonic acid. It shows very good inhibition of the precipitation of barium sulfate (BaSO4). At high alkali and high temperature (above 210 °C) environments DTPMPA has better scale and corrosion inhibition effect than other phosphonates.
Applications
- Detergents and cleaning agents
- Water treatment
- Scaling inhibitor
- Chelating agent
- Deflocculation agent / settling retarder
- Anti corrosion agent