Damascone

{{distinguish|Damascenone}}

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 424876283

| Name=beta-Damascone

| Reference=[https://www.sigmaaldrich.com/US/en/product/sigma/30395 β-Damascone] at Sigma-Aldrich

| ImageFile=damascone.png

| IUPACName=(E)-1-(2,6,6-Trimethyl-1-cyclohexenyl)but-2-en-1-one

| OtherNames=Rose ketones

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=23726-91-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = I75J0X33Q6

| PubChem=5374527

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4524302

| EC_number = 245-842-1

| 3DMet = L01258

| SMILES = O=C(/C1=C(/CCCC1(C)C)C)/C=C/C

| InChI = 1/C13H20O/c1-5-7-11(14)12-10(2)8-6-9-13(12,3)4/h5,7H,6,8-9H2,1-4H3/b7-5+

| InChIKey = BGTBFNDXYDYBEY-FNORWQNLBE

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C13H20O/c1-5-7-11(14)12-10(2)8-6-9-13(12,3)4/h5,7H,6,8-9H2,1-4H3/b7-5+

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = BGTBFNDXYDYBEY-FNORWQNLSA-N

}}

|Section2={{Chembox Properties

| C=13 | H=20 | O=1

| MolarMass=192.30 g/mol

| Appearance=

| Density=0.934 g/mL

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| GHSPictograms = {{GHS07}}{{GHS09}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|315|317|411}}

| PPhrases = {{P-phrases|261|264|272|273|280|302+352|321|332+313|333+313|362|363|391|501}}

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 424876283

| Name=alpha-Damascone

| Reference=

| ImageFile=Alpha-Damascone.svg

| IUPACName=(E)-1-(2,6,6-trimethyl-1-cyclohex-2-enyl)but-2-en-1-one

| OtherNames=Rose ketones

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo= 24720-09-0

| PubChem = 5366077

| ChemSpiderID = 4518000

| EC_number = 246-430-4

| EC_number_Comment=correct ECHA infocard [https://echa.europa.eu/substance-information/-/substanceinfo/100.042.195 100.042.195]

| DTXSID = DTXSID8051912

| ChEBI = 53220

| Beilstein = 2208707

| 3DMet = L01257

| SMILES = C/C=C/C(=O)C1C(=CCCC1(C)C)C

| StdInChI = 1S/C13H20O/c1-5-7-11(14)12-10(2)8-6-9-13(12,3)4/h5,7-8,12H,6,9H2,1-4H3/b7-5+

| StdInChIKey = CRIGTVCBMUKRSL-FNORWQNLSA-N }}

|Section2={{Chembox Properties

| C=13 | H=20 | O=1

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| GHSPictograms = {{GHS07}}{{GHS09}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|302|317|411}}

| PPhrases = {{P-phrases|261|264|270|272|273|280|301+312|302+352|321|330|333+313|363|391|501}}

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Damascones are a series of closely related chemical compounds that are components of a variety of essential oils. The damascones belong to a family of chemicals known as rose ketones, which also includes damascenones and ionones. beta-Damascone is a contributor to the aroma of roses, despite its relatively low concentration, and is an important fragrance chemical used in perfumery.[http://www.leffingwell.com/rose.htm Rose (Rosa damascena)], John C. Leffingwell

The damascones are derived from the degradation of carotenoids.Biogeneration of C13-norisoprenoid compounds: experiments supportive for an apo-carotenoid pathway in grapevines. R. Baumes, J. Wirth, S. Bureau, Y. Gunata and A. Razungles, Analytica Chimica Acta, 29 April 2002,

Volume 458, Issue 1, pages 3–14, {{doi|10.1016/S0003-2670(01)01589-6}}Volatile Compounds Released by Enzymatic Hydrolysis of Glycoconjugates of Leaves and Grape Berries from Vitis vinifera Muscat of Alexandria and Shiraz Cultivars. Jérémie Wirth, Wenfei Guo, Raymond Baumes and Ziya Günata, J. Agric. Food Chem., 2001, 49 (6), pages 2917–2923, {{doi|10.1021/jf001398l}}

See also

References

{{reflist}}

Further reading

  • {{cite book | url = https://books.google.com/books?id=rIoXXL7OGCoC&pg=PA256 | pages = 256–257 | isbn = 978-0-85404-681-2 | author = Charles S. Sell. | year = 2003 | publisher = RSC, Royal Society of Chemistry | location = Cambridge | title = A fragrant introduction to terpenoid chemistry}}

Category:Carotenoids

Category:Enones

Category:Perfume ingredients

Category:Cyclohexenes

B

{{ketone-stub}}