Dammarane

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 425009039

| ImageFile=Dammarane.svg

| ImageSize=200px

| IUPACName=Dammarane{{cite book |author=International Union of Pure and Applied Chemistry |date=2014 |title=Nomenclature of Organic Chemistry: IUPAC Recommendations and Preferred Names 2013 |publisher=The Royal Society of Chemistry |pages=1535 |doi=10.1039/9781849733069 |isbn=978-0-85404-182-4}}

| SystematicName=(1R,3aR,3bR,5aS,9aS,9bR,11aR)-1-[(2R)-6-Methylheptan-2-yl]-3a,3b,6,6,9a-pentamethylhexadecahydro-1H-cyclopenta[a]phenanthrene

| OtherNames=

|Section1={{Chembox Identifiers

| CASNo=545-22-2

| PubChem=9548714

| KEGG=C22609

| SMILES=C[C@H](CCCC(C)C)[C@H]1CC[C@@]2([C@@H]1CC[C@H]3[C@]2(CC[C@@H]4[C@@]3(CCCC4(C)C)C)C)C

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 7827637

| InChI = 1/C30H54/c1-21(2)11-9-12-22(3)23-15-19-29(7)24(23)13-14-26-28(6)18-10-17-27(4,5)25(28)16-20-30(26,29)8/h21-26H,9-20H2,1-8H3/t22-,23-,24-,25+,26-,28+,29-,30-/m1/s1

| InChIKey = OORMXZNMRWBSTK-LGFJJATJBV

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C30H54/c1-21(2)11-9-12-22(3)23-15-19-29(7)24(23)13-14-26-28(6)18-10-17-27(4,5)25(28)16-20-30(26,29)8/h21-26H,9-20H2,1-8H3/t22-,23-,24-,25+,26-,28+,29-,30-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = OORMXZNMRWBSTK-LGFJJATJSA-N

| RTECS =

| MeSHName = C102963

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = CHEBI:36488

}}

|Section2={{Chembox Properties

| Formula=C₃₀H₅₄

| MolarMass=414.75 g/mol

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Dammarane is a tetracyclic triterpene found in sapogenins (forming triterpenoid saponins) like those of ginseng (ginsenosides: panaxatriol and protopanaxadiol). Compounds of the series were first isolated from and named after dammar resin, a natural resin from the tropical trees of the dipterocarp family.{{cite journal |author1=Mills J.S. |author2=Werner A.E.A. | title = The Chemistry of Dammar Resin | journal = Journal of the Chemical Society | pages = 3132–40 | year = 1955|doi=10.1039/jr9550003132 }} Mills J.S. (1956) "The Constitution of the Neutral, Tetracyclic Triterpenes of Dammar Resin" Journal of the Chemical Society 2196-2202