Dapiprazole

{{Short description|Chemical compound}}

{{distinguish|aripiprazole|brexpiprazole}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 460112976

| IUPAC_name = 3-{2-[4-(2-methylphenyl)piperazin-1-yl]ethyl}-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,5-a]pyridine

| image = Dapiprazole.svg

| tradename =

| Drugs.com = {{drugs.com|CDI|dapiprazole}}

| MedlinePlus = a601043

| pregnancy_category = B

| legal_status = Rx-only

| routes_of_administration = Topical (eye drops)

| bioavailability = Negligible when administered topically

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 7155

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 72822-12-9

| ATC_prefix = S01

| ATC_suffix = EX02

| PubChem = 3033538

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00298

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 2298190

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 5RNZ8GJO7K

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07775

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 51066

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1201216

| C=19 | H=27 | N=5

| smiles = n1nc(n2c1CCCC2)CCN4CCN(c3ccccc3C)CC4

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C19H27N5/c1-16-6-2-3-7-17(16)23-14-12-22(13-15-23)11-9-19-21-20-18-8-4-5-10-24(18)19/h2-3,6-7H,4-5,8-15H2,1H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = RFWZESUMWJKKRN-UHFFFAOYSA-N

}}

Dapiprazole (brand name Rev-Eyes) is an alpha-1 blocker. It is used to reverse mydriasis after eye examination.{{cite journal | vauthors = Doughty MJ, Lyle WM | s2cid = 22781280 | title = A review of the clinical pharmacokinetics of pilocarpine, moxisylyte (thymoxamine), and dapiprazole in the reversal of diagnostic pupillary dilation | journal = Optometry and Vision Science | volume = 69 | issue = 5 | pages = 358–68 | date = May 1992 | pmid = 1350669 | doi = 10.1097/00006324-199205000-00005 }}