Darifenacin

{{Short description|Medication for urinary incontinence}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 460773728

| image = Darifenacin.svg

| alt =

| image2 = Darifenacin-hydrobromide-from-xtal-2009-CM-3D-balls.png

| alt2 =

| tradename = Enablex, Emselex

| Drugs.com = {{drugs.com|monograph|darifenacin-hydrobromide}}

| MedlinePlus = a605039

| pregnancy_AU = B3

| pregnancy_US = C

| ATC_prefix = G04

| ATC_suffix = BD10

| ATC_supplemental =

| legal_AU = S4

| legal_UK = POM

| legal_US = Rx-only

| legal_EU = Rx-only

| routes_of_administration = By mouth

| bioavailability = 15 to 19% (dose-dependent)

| protein_bound = 98%

| metabolism = Liver (CYP2D6- and CYP3A4-mediated)

| elimination_half-life = 13 to 19 hours

| excretion = Kidney (60%) and biliary (40%)

| index2_label = as salt

| IUPHAR_ligand = 321

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 133099-04-4

| PubChem = 444031

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00496

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 392054

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = APG9819VLM

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = D03654

| KEGG2_Ref = {{keggcite|changed|kegg}}

| KEGG2 = D01699

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 391960

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1346

| IUPAC_name = (S)-2-[1-[2-(2,3-dihydrobenzofuran-5-yl)ethyl] pyrrolidin-3-yl] -2,2-diphenyl-acetamide

| C=28 | H=30 | N=2 | O=2

| smiles = O=C(N)C(c1ccccc1)(c2ccccc2)[C@H]3CN(CC3)CCc5cc4c(OCC4)cc5

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C28H30N2O2/c29-27(31)28(23-7-3-1-4-8-23,24-9-5-2-6-10-24)25-14-17-30(20-25)16-13-21-11-12-26-22(19-21)15-18-32-26/h1-12,19,25H,13-18,20H2,(H2,29,31)/t25-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = HXGBXQDTNZMWGS-RUZDIDTESA-N

}}

Darifenacin (trade name Enablex in United States and Canada, Emselex in the European Union) is a medication used to treat urinary incontinence due to an overactive bladder.{{cite journal | vauthors = Croom KF, Keating GM | title = Darifenacin: in the treatment of overactive bladder | journal = Drugs & Aging | volume = 21 | issue = 13 | pages = 885–92; discussion 893–4 | date = 2004 | pmid = 15493952 | doi = 10.2165/00002512-200421130-00005 | s2cid = 41549419 }}{{cite journal | vauthors = Parsons M, Robinson D, Cardozo L | title = Darifenacin in the treatment of overactive bladder | journal = International Journal of Clinical Practice | volume = 59 | issue = 7 | pages = 831–8 | date = July 2005 | pmid = 15963212 | doi = 10.1111/j.1368-5031.2005.00585.x | s2cid = 39061659 | doi-access = free }}{{cite journal | vauthors = Chughtai B, Levin R, De E | title = Choice of antimuscarinic agents for overactive bladder in the older patient: focus on darifenacin | journal = Clinical Interventions in Aging | volume = 3 | issue = 3 | pages = 503–9 | date = 2008 | pmid = 18982920 | pmc = 2682382 | doi = 10.2147/cia.s3414 | doi-access = free }} It was discovered by scientists at the Pfizer research site in Sandwich, UK under the identifier UK-88,525 and used to be marketed by Novartis. In 2010, the US rights were sold to Warner Chilcott for {{US$|400 million}}.