Davicil

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 436287114

| ImageFile = Davicil_structure.png

| ImageName = Davicil skeletal structure

| PIN = 2,3,5,6-Tetrachloro-4-(methanesulfonyl)pyridine

| OtherNames = Tetrachloromethylsulfonylpyridine

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 13108-52-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 92AGR11YJB

| PubChem = 61579

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 55492

| SMILES = Clc1c(c(Cl)c(Cl)nc1Cl)S(=O)(=O)C

| InChI = 1/C6H3Cl4NO2S/c1-14(12,13)4-2(7)5(9)11-6(10)3(4)8/h1H3

| InChIKey = NMCCNOZOBBWFMN-UHFFFAOYAE

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C6H3Cl4NO2S/c1-14(12,13)4-2(7)5(9)11-6(10)3(4)8/h1H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = NMCCNOZOBBWFMN-UHFFFAOYSA-N

| SMILES2 = CS(=O)(=O)C1=C(C(=NC(=C1Cl)Cl)Cl)Cl

}}

|Section2={{Chembox Properties

| Formula = C₆H₃Cl₄NO₂S

| MolarMass = 294.970 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Davicil is a chlorinated pyridine derivative with antimicrobial properties, which is used as a fungicide. It can be allergenic in humans and produce contact dermatitis.{{cite journal | vauthors = Oi M, Sumi K, Yokozeki H | title = Occupational allergy in office workers caused by the antifouling desk mat | journal = Contact Dermatitis | volume = 54 | issue = 1 | pages = 60–1 | date = January 2006 | pmid = 16426296 | doi = 10.1111/j.0105-1873.2006.0729c.x | s2cid = 41411425 }}{{cite journal | vauthors = Inoue T, Yagami A, Sano A, Nakagawa M, Abe M, Mori A, Sasaki K, Matsunaga K | display-authors = 6 | title = Contact dermatitis because of antimicrobial coating desk mat | journal = Contact Dermatitis | volume = 58 | issue = 2 | pages = 123–4 | date = February 2008 | pmid = 18186760 | doi = 10.1111/j.1600-0536.2007.01202.x | s2cid = 5513569 }}