Dazoxiben

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 460774030

| ImageFile = Dazoxiben.svg

| ImageSize =

| ImageAlt =

| PIN = 4-[2-(1H-Imidazol-1-yl)ethoxy]benzoic acid

| OtherNames =

|Section1={{Chembox Identifiers

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 09ZFC7974Q

| IUPHAR_ligand = 5175

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB03052

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 267473

| CASNo_Ref = {{cascite|changed|??}}

| CASNo = 78218-09-4

| PubChem = 53001

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 47885

| SMILES = O=C(O)c2ccc(OCCn1ccnc1)cc2

| InChI = 1/C12H12N2O3/c15-12(16)10-1-3-11(4-2-10)17-8-7-14-6-5-13-9-14/h1-6,9H,7-8H2,(H,15,16)

| InChIKey = XQGZSYKGWHUSDH-UHFFFAOYAY

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C12H12N2O3/c15-12(16)10-1-3-11(4-2-10)17-8-7-14-6-5-13-9-14/h1-6,9H,7-8H2,(H,15,16)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = XQGZSYKGWHUSDH-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=12 | H=12 | N=2 | O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Dazoxiben is an orally active thromboxane synthase inhibitor.{{Cite journal

| doi = 10.1111/j.1365-2125.1983.tb02119.x

| last1 = Belch | first1 = J. J.

| last2 = Cormie | first2 = J.

| last3 = Newman | first3 = P.

| last4 = McLaren | first4 = M.

| last5 = Barbenel | first5 = J.

| last6 = Capell | first6 = H.

| last7 = Leiberman | first7 = P.

| last8 = Forbes | first8 = C. D.

| last9 = Prentice | first9 = C. R.

| title = Dazoxiben, a thromboxane synthetase inhibitor, in the treatment of Raynaud's syndrome: A double-blind trial

| journal = British Journal of Clinical Pharmacology

| volume = 15 Suppl 1

| issue = Suppl 1

| pages = 113S–116S

| year = 1983

| pmid = 6337601

| pmc = 1427695

}} It has shown a significant clinical improvement in patients with Raynaud's syndrome.{{Cite journal

| doi = 10.1111/j.1365-2125.1983.tb02119.x

| last1 = Belch | first1 = J. J.

| last2 = Cormie | first2 = J.

| last3 = Newman | first3 = P.

| last4 = McLaren | first4 = M.

| last5 = Barbenel | first5 = J.

| last6 = Capell | first6 = H.

| last7 = Leiberman | first7 = P.

| last8 = Forbes | first8 = C. D.

| last9 = Prentice | first9 = C. R.

| title = Dazoxiben, a thromboxane synthetase inhibitor, in the treatment of Raynaud's syndrome: A double-blind trial

| journal = British Journal of Clinical Pharmacology

| volume = 15 Suppl 1

| issue = Suppl 1

| pages = 113S–116S

| year = 1983

| pmid = 6337601

| pmc = 1427695

}}