Delapril
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 444593478
| IUPAC_name = 2-[2,3-dihydro-1H-inden-2-yl-[(2S)-2-
| image = Delapril.svg
| width = 222
| tradename =
| Drugs.com = {{drugs.com|international|delapril}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 83435-66-9
| ATC_prefix = C09
| ATC_suffix = AA12
| ATC_supplemental =
| PubChem = 5362116
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = W77UAL9THI
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 2106126
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07781
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 4514931
| SMILES = O=C(OCC)[C@@H](N[C@H](C(=O)N(CC(=O)O)C2Cc1ccccc1C2)C)CCc3ccccc3
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C26H32N2O5/c1-3-33-26(32)23(14-13-19-9-5-4-6-10-19)27-18(2)25(31)28(17-24(29)30)22-15-20-11-7-8-12-21(20)16-22/h4-12,18,22-23,27H,3,13-17H2,1-2H3,(H,29,30)/t18-,23-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = WOUOLAUOZXOLJQ-MBSDFSHPSA-N
| C=26 | H=32 | N=2 | O=5
}}
Delapril (INN, also known as alindapril) is an ACE inhibitor used as an antihypertensive drug{{cite journal | vauthors = Otero ML | title = Manidipine-delapril combination in the management of hypertension | journal = Vascular Health and Risk Management | volume = 3 | issue = 3 | pages = 255–63 | year = 2007 | pmid = 17703633 | pmc = 2293964 }} in some European and Asian countries but not in America.{{cite web | work = Drugs.com | url = https://www.drugs.com/international/delapril.html | title = Delapril }} It is taken orally, available in 15 mg and 30 mg tablets.{{cite web | url = http://cursoenarm.net/UPTODATE/contents/mobipreview.htm?16/0/16396?source=HISTORY |title= Delapril |website=cursoenarm.net |access-date=2016-08-28 }}
Mechanism
Delapril is a prodrug; it is converted into two active metabolites, 5-hydroxy delapril diacid and delapril diacid. These metabolites bind completely to and inhibit angiotensin-converting enzyme (ACE), hence blocking angiotensin I to angiotensin II conversion. The resulting vasodilation prevents the vasoconstrictive effects of angiotensin II. Angiotensin II-induced aldosterone secretion by the adrenal cortex is also decreased by Delapril, leading to increases in excretion of sodium and therefore increases water outflow.{{Cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/delapril#section=Pharmacology-and-Biochemistry |title= Delapril | work = Pubchem | publisher = U.S. National Library of Medicine |access-date=2016-08-28}}
References
{{reflist}}
{{ACE inhibitors}}
{{Angiotensin receptor modulators}}