Delgocitinib

{{Short description|Chemical compound}}

{{Use dmy dates|date=August 2024}}

{{cs1 config |name-list-style=vanc |display-authors=6}}

{{Infobox drug

| image = Delgocitinib.svg

| alt =

| caption =

| pronounce =

| tradename = Corectim, others

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| routes_of_administration =

| ATC_prefix = D11

| ATC_suffix = AH11

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU = Rx-only

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status = JP: Rx-only

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action=

| excretion =

| CAS_number = 1263774-59-9

| PubChem = 50914062

| ChemSpiderID = 59718502

| DrugBank = DB16133

| KEGG = D11046

| UNII = 9L0Q8KK220

| synonyms = JTE-052; JTE-052A

| IUPAC_name = 3-[(3S,4R)-3-Methyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,7-diazaspiro[3.4]octan-1-yl]-3-oxopropanenitrile

| C=16 | H=18 | N=6 | O=1

| StdInChI=1S/C16H18N6O/c1-11-8-22(13(23)2-5-17)16(11)4-7-21(9-16)15-12-3-6-18-14(12)19-10-20-15/h3,6,10-11H,2,4,7-9H2,1H3,(H,18,19,20)/t11-,16-/m0/s1

| StdInChIKey = LOWWYYZBZNSPDT-ZBEGNZNMSA-N

| SMILES = C[C@H]1CN(C(=O)CC#N)[C@]12CCN(c1ncnc3[nH]ccc13)C2

}}

Delgocitinib, sold under the brand name Corectim among others, is a medication used for the treatment of autoimmune disorders and hypersensitivity, including inflammatory skin conditions.{{cite journal | vauthors = Dhillon S | title = Delgocitinib: First Approval | journal = Drugs | volume = 80 | issue = 6 | pages = 609–615 | date = April 2020 | pmid = 32166597 | doi = 10.1007/s40265-020-01291-2 | s2cid = 212681247 }} Delgocitinib was developed by Japan Tobacco and approved in Japan for the treatment of atopic dermatitis. In the United States, delgocitinib is in Phase III clinical trials and the Food and Drug Administration has granted delgocitinib fast track designation for topical treatment of adults with moderate to severe chronic hand eczema.{{cite news | url = https://www.empr.com/home/news/delgocitinib-cream-leo-pharma-chronic-hand-eczema | date = August 5, 2020 | title = Delgocitinib Cream Gets Fast Track Status for Chronic Hand Eczema | vauthors = Park B | website = empr.com}}

Delgocitinib works by blocking activation of the JAK-STAT signaling pathway which contributes to the pathogenesis of chronic inflammatory skin diseases.{{cite journal | vauthors = Szalus K, Trzeciak M, Nowicki RJ | title = JAK-STAT Inhibitors in Atopic Dermatitis from Pathogenesis to Clinical Trials Results | journal = Microorganisms | volume = 8 | issue = 11 | page = 1743 | date = November 2020 | pmid = 33172122 | pmc = 7694787 | doi = 10.3390/microorganisms8111743 | doi-access = free }}