Delmadinone

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 6-chloro-17-hydroxypregna-1,4,6-triene-3,20-dione

| image = Delmadinone.svg

| alt = Skeletal formula of delmadinone

| image2 = Delmadinone 3D ball.png

| alt2 = Ball-and-stick model of the delmadinone molecule

| CAS_number = 15262-77-8

| CAS_supplemental =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = WFF40U3U3O

| ATCvet = yes

| ATC_prefix = G03

| ATC_suffix = DX91

| PubChem = 10428639

| ChemSpiderID = 8604067

| C=21 | H=25 | Cl=1 | O=3

| smiles = O=C\1\C=C/[C@]4(C(=C/1)C(\Cl)=C/[C@@H]2[C@@H]4CC[C@@]3([C@@](O)(C(=O)C)CC[C@@H]23)C)C

| StdInChI = 1S/C21H25ClO3/c1-12(23)21(25)9-6-16-14-11-18(22)17-10-13(24)4-7-19(17,2)15(14)5-8-20(16,21)3/h4,7,10-11,14-16,25H,5-6,8-9H2,1-3H3/t14-,15+,16+,19-,20+,21+/m1/s1

| StdInChIKey = ZSAMZEYLGUEVJW-TTYLFXKOSA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_category =

| legal_status =

| routes_of_administration =

}}

Delmadinone (INN) is a steroidal progestin which was never marketed.{{cite book | vauthors = Macdonald F | title = Dictionary of Pharmacological Agents | url = https://books.google.com/books?id=DeX7jgInYFMC&pg=PA579 | access-date = 30 May 2012 | year = 1997 | publisher = CRC Press | isbn = 978-0-412-46630-4 | page = 579}}{{cite book | title = Index Nominum 2000: International Drug Directory | url = https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA298 | access-date = 30 May 2012 | year = 2000 | publisher = Taylor & Francis US | isbn = 978-3-88763-075-1 | page = 298}} An acylated derivative, delmadinone acetate, is used in veterinary medicine.

While delmadinone is sometimes used as a synonym for delmadinone acetate, it usually refers to delmadinone acetate, not delmadinone.