Delucemine

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 443754937

| IUPAC_name = 3,3-Bis(3-fluorophenyl)-N-methylpropan-1-amine

| image = Delucemine.svg

| image_class = skin-invert-image

| width = 250

| tradename =

| routes_of_administration =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 186495-49-8

| ATC_prefix = none

| PubChem = 156421

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2106165

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 124LSR3H2X

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 137745

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C16H17F2N/c1-19-9-8-16(12-4-2-6-14(17)10-12)13-5-3-7-15(18)11-13/h2-7,10-11,16,19H,8-9H2,1H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = MUGNLPWYHGOJEG-UHFFFAOYSA-N

| C=16 | H=17 | F=2 | N=1

| smiles = CNCCC(C1=CC(=CC=C1)F)C2=CC(=CC=C2)F

}}

Delucemine (NPS-1506) is a drug which acts as an NMDA antagonist and a serotonin reuptake inhibitor, and has neuroprotective effects.{{cite journal | vauthors = Mueller AL, Artman LD, Balandrin MF, Brady E, Chien Y, Delmar EG, George K, Kierstead A, Marriott TB, Moe ST, Newman MK, Raszkiewicz JL, Sanguinetti EL, van Wagenen BC, Wells D | title = NPS 1506, a novel NMDA receptor antagonist and neuroprotectant. Review of preclinical and clinical studies | journal = Annals of the New York Academy of Sciences | volume = 890 | pages = 450–7 | date = December 1999 | issue = 1 | pmid = 10668449 | doi = 10.1111/j.1749-6632.1999.tb08023.x | bibcode = 1999NYASA.890..450M | s2cid = 5629889 }}{{cite journal | vauthors = Leoni MJ, Chen XH, Mueller AL, Cheney J, McIntosh TK, Smith DH | title = NPS 1506 attenuates cognitive dysfunction and hippocampal neuron death following brain trauma in the rat | journal = Experimental Neurology | volume = 166 | issue = 2 | pages = 442–9 | date = December 2000 | pmid = 11085909 | doi = 10.1006/exnr.2000.7513 | s2cid = 39222349 }} It was originally investigated for the treatment of stroke and in 2004 was studied as a potential antidepressant.{{cite web|url=http://edgar.secdatabase.com/173/119312504090111/filing-main.htm |title=NPS Pharmaceuticals Inc, Form 10-Q, Quarterly Report, Filing Date May 17, 2004 |publisher=secdatabase.com |access-date =May 14, 2018}}{{cite patent | country = CA | number = 2599721 | title = Pharmaceutical compositions for the treatment and/or prevention of depression | inventor = Pyke R, Ceci A}}{{cite patent | country = WO | number = 2014015047 | title = Compositions and methods to treat neurodegenerative diseases | inventor = Ichinose F, Marutani E, Kida K }}